Attributes
UniProt ID
Protein Name
Beta-galactosidase
Ligand Name
D-galactonolactone
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
PHOQVHQSTUBQQK-MGCNEYSASA-N
SMILES
C(C1C(C(C(C(=O)O1)O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3I3B
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3i3bA1e3i3bA2e3i3bA3e3i3bA4e3i3bA5e3i3bB1e3i3bB2e3i3bB3e3i3bB4e3i3bB5e3i3bC1e3i3bC2e3i3bC3e3i3bC4e3i3bC5e3i3bD1e3i3bD2e3i3bD3e3i3bD4e3i3bD5
ECOD domains from experimental PDB structures interacting with ligand DB01885
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| B8LFD6 | DB01885 | 149 | 3i3b | e3i3bA1 | A:13-219 |
| B8LFD6 | DB01885 | 149 | 3i3b | e3i3bA4 | A:731-1023 |
| B8LFD6 | DB01885 | 149 | 3i3b | e3i3bA5 | A:334-625 |
| B8LFD6 | DB01885 | 149 | 3i3b | e3i3bB1 | B:13-219 |
| B8LFD6 | DB01885 | 149 | 3i3b | e3i3bB4 | B:731-1023 |
| B8LFD6 | DB01885 | 149 | 3i3b | e3i3bB5 | B:334-625 |
| B8LFD6 | DB01885 | 149 | 3i3b | e3i3bC1 | C:13-219 |
| B8LFD6 | DB01885 | 149 | 3i3b | e3i3bC4 | C:731-1023 |
| B8LFD6 | DB01885 | 149 | 3i3b | e3i3bC5 | C:334-625 |
| B8LFD6 | DB01885 | 149 | 3i3b | e3i3bD1 | D:13-219 |
| B8LFD6 | DB01885 | 149 | 3i3b | e3i3bD4 | D:731-1023 |
| B8LFD6 | DB01885 | 149 | 3i3b | e3i3bD5 | D:334-625 |
| B8LFD6 | DB01885 | 149 | 3mv0 | e3mv011 | 1:13-219 |
| B8LFD6 | DB01885 | 149 | 3mv0 | e3mv014 | 1:731-1023 |
| B8LFD6 | DB01885 | 149 | 3mv0 | e3mv015 | 1:334-625 |
| B8LFD6 | DB01885 | 149 | 3mv0 | e3mv021 | 2:13-219 |
| B8LFD6 | DB01885 | 149 | 3mv0 | e3mv024 | 2:731-1023 |
| B8LFD6 | DB01885 | 149 | 3mv0 | e3mv025 | 2:334-625 |
| B8LFD6 | DB01885 | 149 | 3mv0 | e3mv031 | 3:13-219 |
| B8LFD6 | DB01885 | 149 | 3mv0 | e3mv034 | 3:731-1023 |
| B8LFD6 | DB01885 | 149 | 3mv0 | e3mv035 | 3:334-625 |
| B8LFD6 | DB01885 | 149 | 3mv0 | e3mv041 | 4:13-219 |
| B8LFD6 | DB01885 | 149 | 3mv0 | e3mv044 | 4:731-1023 |
| B8LFD6 | DB01885 | 149 | 3mv0 | e3mv045 | 4:334-625 |