Attributes
UniProt ID
Protein Name
Polymerase acidic protein
Ligand Name
Baloxavir acid
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
FIDLLEYNNRGVFR-CTNGQTDRSA-N
SMILES
c1ccc2c(c1)C(c3ccc(c(c3CS2)F)F)N4C5COCCN5C(=O)C6=C(C(=O)C=CN64)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6FS6
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6fs6A1e6fs6B1e6fs6C1e6fs6D1e6fs6E1e6fs6F1
ECOD domains from experimental PDB structures interacting with ligand DB15675
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| C3W5S0 | DB15675 | E4Z | 6fs6 | e6fs6A1 | A:-1-198 |
| C3W5S0 | DB15675 | E4Z | 6fs6 | e6fs6B1 | B:-1-198 |
| C3W5S0 | DB15675 | E4Z | 6fs6 | e6fs6C1 | C:-1-198 |
| C3W5S0 | DB15675 | E4Z | 6fs6 | e6fs6D1 | D:-1-198 |
| C3W5S0 | DB15675 | E4Z | 6fs6 | e6fs6E1 | E:-1-198 |
| C3W5S0 | DB15675 | E4Z | 6fs6 | e6fs6F1 | F:0-198 |
| C3W5S0 | DB15675 | E4Z | 6fs7 | e6fs7A1 | A:-4-198 |
| C3W5S0 | DB15675 | E4Z | 6fs7 | e6fs7B1 | B:-5-198 |
| C3W5S0 | DB15675 | E4Z | 6fs7 | e6fs7C1 | C:-3-198 |
| C3W5S0 | DB15675 | E4Z | 6fs7 | e6fs7D1 | D:-2-198 |
| C3W5S0 | DB15675 | E4Z | 6fs7 | e6fs7E1 | E:-2-198 |
| C3W5S0 | DB15675 | E4Z | 6fs7 | e6fs7F1 | F:-2-198 |
| C3W5S0 | DB15675 | E4Z | 7k0w | e7k0wA1 | A:-2-195 |