Attributes
UniProt ID
Protein Name
propionyl-CoA carboxylase
Ligand Name
5-(HEXAHYDRO-2-OXO-1H-THIENO[3,4-D]IMIDAZOL-6-YL)PENTANAL
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ARDNWGMSCXSPBF-CIUDSAMLSA-N
SMILES
C1C2C(C(S1)CCCCC=O)NC(=O)N2
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6YBP
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6ybpA1e6ybpA2e6ybpB1e6ybpB2e6ybpC1e6ybpC2e6ybpD1e6ybpD2e6ybpE1e6ybpE2e6ybpF1e6ybpF2e6ybpG1e6ybpG2e6ybpG3e6ybpH1e6ybpH2e6ybpI1e6ybpI2e6ybpI3e6ybpJ1e6ybpJ2e6ybpJ3e6ybpK1e6ybpK2e6ybpK3e6ybpL1e6ybpL2e6ybpL3
ECOD domains from experimental PDB structures interacting with ligand DB07497
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| C5AWU5 | DB07497 | BTI | 6ybp | e6ybpG2 | G:595-666 |
| C5AWU5 | DB07497 | BTI | 6ybp | e6ybpH1 | H:595-666 |
| C5AWU5 | DB07497 | BTI | 6ybp | e6ybpI2 | I:595-666 |
| C5AWU5 | DB07497 | BTI | 6ybp | e6ybpJ2 | J:595-666 |
| C5AWU5 | DB07497 | BTI | 6ybp | e6ybpK2 | K:595-666 |
| C5AWU5 | DB07497 | BTI | 6ybp | e6ybpL2 | L:595-666 |
| C5AWU5 | DB07497 | BTI | 6ybq | e6ybqG1 | G:595-666 |
| C5AWU5 | DB07497 | BTI | 6ybq | e6ybqH1 | H:595-666 |
| C5AWU5 | DB07497 | BTI | 6ybq | e6ybqI1 | I:595-666 |
| C5AWU5 | DB07497 | BTI | 6ybq | e6ybqJ1 | J:595-666 |
| C5AWU5 | DB07497 | BTI | 6ybq | e6ybqK1 | K:595-666 |
| C5AWU5 | DB07497 | BTI | 6ybq | e6ybqL1 | L:595-666 |
| C5AWU5 | DB07497 | BTI | 8pn7 | e8pn7G2 | G:595-666 |
| C5AWU5 | DB07497 | BTI | 8pn7 | e8pn7H2 | H:595-666 |
| C5AWU5 | DB07497 | BTI | 8pn7 | e8pn7I2 | I:595-666 |
| C5AWU5 | DB07497 | BTI | 8pn7 | e8pn7J2 | J:595-666 |
| C5AWU5 | DB07497 | BTI | 8pn7 | e8pn7K2 | K:595-666 |
| C5AWU5 | DB07497 | BTI | 8pn7 | e8pn7L2 | L:595-666 |
| C5AWU5 | DB07497 | BTI | 8pn8 | e8pn8G2 | G:595-666 |
| C5AWU5 | DB07497 | BTI | 8pn8 | e8pn8H2 | H:595-666 |
| C5AWU5 | DB07497 | BTI | 8pn8 | e8pn8I2 | I:595-666 |
| C5AWU5 | DB07497 | BTI | 8pn8 | e8pn8J2 | J:595-666 |
| C5AWU5 | DB07497 | BTI | 8pn8 | e8pn8K2 | K:595-666 |
| C5AWU5 | DB07497 | BTI | 8pn8 | e8pn8L2 | L:595-666 |