Attributes
UniProt ID
Protein Name
n/a
Ligand Name
ADENOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XTWYTFMLZFPYCI-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3RER
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3rerA1e3rerB1e3rerC1e3rerD1e3rerE1e3rerF1
ECOD domains from experimental PDB structures interacting with ligand DB16833
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| C5W5L7 | DB16833 | ADP | 3rer | e3rerA1 | A:6-65 |
| C5W5L7 | DB16833 | ADP | 3rer | e3rerB1 | B:4-65 |
| C5W5L7 | DB16833 | ADP | 3rer | e3rerC1 | C:2-65 |
| C5W5L7 | DB16833 | ADP | 3rer | e3rerD1 | D:5-65 |
| C5W5L7 | DB16833 | ADP | 3rer | e3rerE1 | E:6-65 |
| C5W5L7 | DB16833 | ADP | 3rer | e3rerF1 | F:5-65 |
| C5W5L7 | DB16833 | ADP | 3res | e3resA1 | A:4-65 |
| C5W5L7 | DB16833 | ADP | 3res | e3resB1 | B:6-65 |
| C5W5L7 | DB16833 | ADP | 3res | e3resC1 | C:5-65 |
| C5W5L7 | DB16833 | ADP | 3res | e3resD1 | D:5-65 |
| C5W5L7 | DB16833 | ADP | 3res | e3resE1 | E:6-65 |
| C5W5L7 | DB16833 | ADP | 3res | e3resF1 | F:6-65 |
| C5W5L7 | DB16833 | ADP | 3res | e3resG1 | G:6-65 |
| C5W5L7 | DB16833 | ADP | 3res | e3resH1 | H:6-65 |
| C5W5L7 | DB16833 | ADP | 3res | e3resI1 | I:6-65 |
| C5W5L7 | DB16833 | ADP | 3res | e3resJ1 | J:5-65 |
| C5W5L7 | DB16833 | ADP | 3res | e3resK1 | K:6-65 |
| C5W5L7 | DB16833 | ADP | 3res | e3resL1 | L:6-65 |