Attributes
UniProt ID
Protein Name
3-hydroxybutyrate dehydrogenase
Ligand Name
NICOTINAMIDE-ADENINE-DINUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
BAWFJGJZGIEFAR-NNYOXOHSSA-N
SMILES
c1cc(c[n+](c1)C2C(C(C(O2)COP(=O)([O-])OP(=O)(O)OCC3C(C(C(O3)n4cnc5c4ncnc5N)O)O)O)O)C(=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3VDQ
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3vdqA1e3vdqB1e3vdqC1e3vdqD1
ECOD domains from experimental PDB structures interacting with ligand DB14128
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| D0VWQ0 | DB14128 | NAD | 3vdq | e3vdqA1 | A:1-260 |
| D0VWQ0 | DB14128 | NAD | 3vdq | e3vdqB1 | B:1-260 |
| D0VWQ0 | DB14128 | NAD | 3vdq | e3vdqC1 | C:1-260 |
| D0VWQ0 | DB14128 | NAD | 3vdq | e3vdqD1 | D:1-260 |
| D0VWQ0 | DB14128 | NAD | 3vdr | e3vdrA1 | A:1-260 |
| D0VWQ0 | DB14128 | NAD | 3vdr | e3vdrB1 | B:1-260 |
| D0VWQ0 | DB14128 | NAD | 3vdr | e3vdrC1 | C:1-260 |
| D0VWQ0 | DB14128 | NAD | 3vdr | e3vdrD1 | D:1-260 |
| D0VWQ0 | DB14128 | NAD | 3w8d | e3w8dA1 | A:1-260 |
| D0VWQ0 | DB14128 | NAD | 3w8e | e3w8eA1 | A:1-260 |
| D0VWQ0 | DB14128 | NAD | 3w8f | e3w8fA1 | A:1-260 |
| D0VWQ0 | DB14128 | NAD | 5b4t | e5b4tA1 | A:1-260 |
| D0VWQ0 | DB14128 | NAD | 5b4u | e5b4uA1 | A:1-260 |
| D0VWQ0 | DB14128 | NAD | 5b4v | e5b4vA1 | A:1-260 |