Attributes
UniProt ID
Protein Name
Photosystem II CP47 reaction center protein
Ligand Name
(3R)-beta,beta-caroten-3-ol
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
DMASLKHVQRHNES-FKKUPVFPSA-N
SMILES
CC1=C(C(CCC1)(C)C)C=CC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC2=C(CC(CC2(C)C)O)C)C)C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3WU2
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3wu2A1e3wu2B1e3wu2B2e3wu2C1e3wu2D1e3wu2E1e3wu2F1e3wu2H1e3wu2I1e3wu2J1e3wu2K1e3wu2L1e3wu2M1e3wu2O1e3wu2T1e3wu2U1e3wu2V1e3wu2X1e3wu2Y1e3wu2Z1e3wu2a1e3wu2b1e3wu2b2e3wu2c1e3wu2d1e3wu2e1e3wu2f1e3wu2h1e3wu2i1e3wu2j1e3wu2k1e3wu2l1e3wu2m1e3wu2o1e3wu2t1e3wu2u1e3wu2v1e3wu2x1e3wu2y1e3wu2z1
ECOD domains from experimental PDB structures interacting with ligand DB15914
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| D0VWR1 | DB15914 | RRX | 3wu2 | e3wu2B2 | B:2-328,B:445-505 |
| D0VWR1 | DB15914 | RRX | 3wu2 | e3wu2b2 | b:2-328,b:445-504 |
| D0VWR1 | DB15914 | RRX | 5b5e | e5b5eB2 | B:2-328,B:445-506 |
| D0VWR1 | DB15914 | RRX | 5b5e | e5b5eb2 | b:2-328,b:445-504 |
| D0VWR1 | DB15914 | RRX | 5b66 | e5b66B1 | B:2-328,B:445-506 |
| D0VWR1 | DB15914 | RRX | 5b66 | e5b66b2 | b:2-328,b:445-504 |
| D0VWR1 | DB15914 | RRX | 7d1t | e7d1tB1 | B:2-328,B:445-505 |
| D0VWR1 | DB15914 | RRX | 7d1t | e7d1tb2 | b:2-328,b:445-505 |
| D0VWR1 | DB15914 | RRX | 7d1u | e7d1uB2 | B:2-328,B:445-505 |
| D0VWR1 | DB15914 | RRX | 7d1u | e7d1ub1 | b:2-328,b:445-505 |
| D0VWR1 | DB15914 | RRX | 7eda | e7edaB2 | B:2-328,B:445-505 |
| D0VWR1 | DB15914 | RRX | 8gn0 | e8gn0B1 | B:2-328,B:445-506 |
| D0VWR1 | DB15914 | RRX | 8gn1 | e8gn1B1 | B:2-328,B:445-506 |
| D0VWR1 | DB15914 | RRX | 8gn1 | e8gn1b2 | b:2-328,b:445-504 |
| D0VWR1 | DB15914 | RRX | 8gn2 | e8gn2B2 | B:2-328,B:445-506 |
| D0VWR1 | DB15914 | RRX | 8gn2 | e8gn2b1 | b:2-328,b:445-504 |