Attributes
UniProt ID
Protein Name
Tubulin beta chain
Ligand Name
N-[(7S)-1,2,3,10-tetramethoxy-9-oxo-6,7-dihydro-5H-benzo[d]heptalen-7-yl]ethanamide
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
IAKHMKGGTNLKSZ-INIZCTEOSA-N
SMILES
CC(=O)NC1CCc2cc(c(c(c2C3=CC=C(C(=O)C=C13)OC)OC)OC)OC
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3UT5
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3ut5A3e3ut5A4e3ut5B3e3ut5B4e3ut5C3e3ut5C4e3ut5D3e3ut5D4e3ut5E1
ECOD domains from experimental PDB structures interacting with ligand DB01394
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| D0VWY9 | DB01394 | LOC | 3ut5 | e3ut5B3 | B:246-442 |
| D0VWY9 | DB01394 | LOC | 3ut5 | e3ut5B4 | B:1-245 |
| D0VWY9 | DB01394 | LOC | 3ut5 | e3ut5D3 | D:246-442 |
| D0VWY9 | DB01394 | LOC | 3ut5 | e3ut5D4 | D:1-245 |
| D0VWY9 | DB01394 | LOC | 4x1i | e4x1iB1 | B:3-245 |
| D0VWY9 | DB01394 | LOC | 4x1i | e4x1iB2 | B:246-440 |
| D0VWY9 | DB01394 | LOC | 4x1i | e4x1iD1 | D:2-245 |
| D0VWY9 | DB01394 | LOC | 4x1i | e4x1iD2 | D:246-441 |
| D0VWY9 | DB01394 | LOC | 4x1k | e4x1kB1 | B:246-440 |
| D0VWY9 | DB01394 | LOC | 4x1k | e4x1kB2 | B:3-245 |
| D0VWY9 | DB01394 | LOC | 4x1k | e4x1kD1 | D:246-441 |
| D0VWY9 | DB01394 | LOC | 4x1k | e4x1kD2 | D:2-245 |
| D0VWY9 | DB01394 | LOC | 4x1y | e4x1yB1 | B:246-440 |
| D0VWY9 | DB01394 | LOC | 4x1y | e4x1yB2 | B:3-245 |
| D0VWY9 | DB01394 | LOC | 4x1y | e4x1yD1 | D:2-245 |
| D0VWY9 | DB01394 | LOC | 4x1y | e4x1yD2 | D:246-441 |
| D0VWY9 | DB01394 | LOC | 4x20 | e4x20B1 | B:246-440 |
| D0VWY9 | DB01394 | LOC | 4x20 | e4x20B2 | B:3-245 |
| D0VWY9 | DB01394 | LOC | 4x20 | e4x20D1 | D:246-441 |
| D0VWY9 | DB01394 | LOC | 4x20 | e4x20D2 | D:2-245 |
| D0VWY9 | DB01394 | LOC | 5eyp | e5eypB1 | B:1-245 |
| D0VWY9 | DB01394 | LOC | 5eyp | e5eypB2 | B:246-441 |
| D0VWY9 | DB01394 | LOC | 5mio | e5mioB1 | B:1-245 |
| D0VWY9 | DB01394 | LOC | 5mio | e5mioB2 | B:246-438 |