Attributes
UniProt ID
Protein Name
Tubulin alpha chain
Ligand Name
N-[(7S)-1,2,3,10-tetramethoxy-9-oxo-6,7-dihydro-5H-benzo[d]heptalen-7-yl]ethanamide
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
IAKHMKGGTNLKSZ-INIZCTEOSA-N
SMILES
CC(=O)NC1CCc2cc(c(c(c2C3=CC=C(C(=O)C=C13)OC)OC)OC)OC
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3UT5
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3ut5A3e3ut5A4e3ut5B3e3ut5B4e3ut5C3e3ut5C4e3ut5D3e3ut5D4e3ut5E1
ECOD domains from experimental PDB structures interacting with ligand DB01394
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| D0VWZ0 | DB01394 | LOC | 3ut5 | e3ut5A3 | A:245-440 |
| D0VWZ0 | DB01394 | LOC | 3ut5 | e3ut5A4 | A:1-244 |
| D0VWZ0 | DB01394 | LOC | 3ut5 | e3ut5C4 | C:1-244 |
| D0VWZ0 | DB01394 | LOC | 4x1i | e4x1iA1 | A:2-245 |
| D0VWZ0 | DB01394 | LOC | 4x1i | e4x1iA2 | A:246-437 |
| D0VWZ0 | DB01394 | LOC | 4x1i | e4x1iC1 | C:1-244 |
| D0VWZ0 | DB01394 | LOC | 4x1k | e4x1kA1 | A:246-437 |
| D0VWZ0 | DB01394 | LOC | 4x1k | e4x1kA2 | A:2-245 |
| D0VWZ0 | DB01394 | LOC | 4x1k | e4x1kC2 | C:1-245 |
| D0VWZ0 | DB01394 | LOC | 4x1y | e4x1yA1 | A:2-245 |
| D0VWZ0 | DB01394 | LOC | 4x1y | e4x1yA2 | A:246-437 |
| D0VWZ0 | DB01394 | LOC | 4x1y | e4x1yC1 | C:1-245 |
| D0VWZ0 | DB01394 | LOC | 4x20 | e4x20A1 | A:246-437 |
| D0VWZ0 | DB01394 | LOC | 4x20 | e4x20A2 | A:2-245 |
| D0VWZ0 | DB01394 | LOC | 4x20 | e4x20C1 | C:1-245 |
| D0VWZ0 | DB01394 | LOC | 5eyp | e5eypA1 | A:245-437 |
| D0VWZ0 | DB01394 | LOC | 5eyp | e5eypA2 | A:1-244 |