Attributes
UniProt ID
Protein Name
Thiosulfate dehydrogenase
Ligand Name
HEME C
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
HXQIYSLZKNYNMH-LJNAALQVSA-N
SMILES
CC=C1C(=C2C=C3C(=CC)C(=C4N3[Fe]56N2C1=Cc7n5c(c(c7C)CCC(=O)O)C=C8N6C(=C4)C(=C8CCC(=O)O)C)C)C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4V2K
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4v2kA1e4v2kA2
ECOD domains from experimental PDB structures interacting with ligand DB03317
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| D3RVD4 | DB03317 | HEC | 4v2k | e4v2kA1 | A:31-164 |
| D3RVD4 | DB03317 | HEC | 4v2k | e4v2kA2 | A:165-265 |
| D3RVD4 | DB03317 | HEC | 4wq7 | e4wq7A1 | A:5-137 |
| D3RVD4 | DB03317 | HEC | 4wq7 | e4wq7A2 | A:138-237 |
| D3RVD4 | DB03317 | HEC | 4wq8 | e4wq8A1 | A:5-137 |
| D3RVD4 | DB03317 | HEC | 4wq8 | e4wq8A2 | A:138-237 |
| D3RVD4 | DB03317 | HEC | 4wq9 | e4wq9A1 | A:5-137 |
| D3RVD4 | DB03317 | HEC | 4wq9 | e4wq9A2 | A:138-237 |
| D3RVD4 | DB03317 | HEC | 4wqa | e4wqaA1 | A:5-137 |
| D3RVD4 | DB03317 | HEC | 4wqa | e4wqaA2 | A:138-237 |
| D3RVD4 | DB03317 | HEC | 4wqb | e4wqbA1 | A:5-137 |
| D3RVD4 | DB03317 | HEC | 4wqb | e4wqbA2 | A:138-237 |
| D3RVD4 | DB03317 | HEC | 4wqc | e4wqcA1 | A:5-137 |
| D3RVD4 | DB03317 | HEC | 4wqc | e4wqcA2 | A:138-237 |
| D3RVD4 | DB03317 | HEC | 4wqd | e4wqdA1 | A:5-137 |
| D3RVD4 | DB03317 | HEC | 4wqd | e4wqdA2 | A:138-237 |
| D3RVD4 | DB03317 | HEC | 4wqe | e4wqeA1 | A:5-137 |
| D3RVD4 | DB03317 | HEC | 4wqe | e4wqeA2 | A:138-237 |