Attributes
UniProt ID
Protein Name
Aminotransferase class IV
Ligand Name
PYRIDOXAL-5'-PHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
NGVDGCNFYWLIFO-UHFFFAOYSA-N
SMILES
Cc1c(c(c(cn1)COP(=O)(O)O)C=O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 8AHR
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse8ahrA1e8ahrA2e8ahrB1e8ahrB2
ECOD domains from experimental PDB structures interacting with ligand DB00114
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| D5EHC5 | DB00114 | PLP | 8ahr | e8ahrA1 | A:-1-115 |
| D5EHC5 | DB00114 | PLP | 8ahr | e8ahrA2 | A:114-275 |
| D5EHC5 | DB00114 | PLP | 8ahr | e8ahrB1 | B:-1-115 |
| D5EHC5 | DB00114 | PLP | 8ahr | e8ahrB2 | B:114-275 |
| D5EHC5 | DB00114 | PLP | 8ayj | e8ayjA1 | A:0-115 |
| D5EHC5 | DB00114 | PLP | 8ayj | e8ayjA2 | A:114-275 |
| D5EHC5 | DB00114 | PLP | 8ayj | e8ayjB1 | B:114-275 |
| D5EHC5 | DB00114 | PLP | 8ayj | e8ayjB2 | B:0-115 |
| D5EHC5 | DB00114 | PLP | 8onj | e8onjA1 | A:114-275 |
| D5EHC5 | DB00114 | PLP | 8onj | e8onjA2 | A:-1-115 |
| D5EHC5 | DB00114 | PLP | 8onj | e8onjB1 | B:114-275 |
| D5EHC5 | DB00114 | PLP | 8onj | e8onjB2 | B:1-115 |
| D5EHC5 | DB00114 | PLP | 8onl | e8onlA1 | A:114-275 |
| D5EHC5 | DB00114 | PLP | 8onl | e8onlA2 | A:-1-115 |
| D5EHC5 | DB00114 | PLP | 8onl | e8onlB1 | B:1-115 |
| D5EHC5 | DB00114 | PLP | 8onl | e8onlB2 | B:114-275 |