Attributes
UniProt ID
Protein Name
Chromate reductase
Ligand Name
FLAVIN MONONUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
FVTCRASFADXXNN-SCRDCRAPSA-N
SMILES
Cc1cc2c(cc1C)N(C3=NC(=O)NC(=O)C3=N2)CC(C(C(COP(=O)(O)O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3S2Y
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3s2yA2e3s2yB2e3s2yC2e3s2yD2
ECOD domains from experimental PDB structures interacting with ligand DB03247
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| D5QFC5 | DB03247 | FMN | 3s2y | e3s2yA2 | A:5-188 |
| D5QFC5 | DB03247 | FMN | 3s2y | e3s2yB2 | B:6-187 |
| D5QFC5 | DB03247 | FMN | 3s2y | e3s2yC2 | C:6-186 |
| D5QFC5 | DB03247 | FMN | 3s2y | e3s2yD2 | D:6-187 |
| D5QFC5 | DB03247 | FMN | 4h6p | e4h6pA3 | A:5-188 |
| D5QFC5 | DB03247 | FMN | 4h6p | e4h6pB2 | B:5-188 |
| D5QFC5 | DB03247 | FMN | 4h6p | e4h6pC2 | C:5-188 |
| D5QFC5 | DB03247 | FMN | 4h6p | e4h6pD2 | D:5-188 |
| D5QFC5 | DB03247 | FMN | 4h6p | e4h6pE2 | E:5-188 |
| D5QFC5 | DB03247 | FMN | 4h6p | e4h6pF2 | F:5-188 |
| D5QFC5 | DB03247 | FMN | 4h6p | e4h6pG2 | G:5-188 |
| D5QFC5 | DB03247 | FMN | 4h6p | e4h6pH2 | H:5-188 |
| D5QFC5 | DB03247 | FMN | 4h6p | e4h6pI2 | I:5-188 |
| D5QFC5 | DB03247 | FMN | 4h6p | e4h6pJ2 | J:5-188 |
| D5QFC5 | DB03247 | FMN | 4h6p | e4h6pK2 | K:5-188 |
| D5QFC5 | DB03247 | FMN | 4h6p | e4h6pL2 | L:5-188 |
| D5QFC5 | DB03247 | FMN | 4hs4 | e4hs4B2 | B:5-188 |
| D5QFC5 | DB03247 | FMN | 4hs4 | e4hs4C2 | C:5-188 |
| D5QFC5 | DB03247 | FMN | 4hs4 | e4hs4D2 | D:5-188 |
| D5QFC5 | DB03247 | FMN | 4hs4 | e4hs4F2 | F:5-188 |
| D5QFC5 | DB03247 | FMN | 4hs4 | e4hs4G2 | G:5-188 |
| D5QFC5 | DB03247 | FMN | 4hs4 | e4hs4H2 | H:5-188 |