Attributes
UniProt ID
Protein Name
Mercuric reductase reductase
Ligand Name
FLAVIN-ADENINE DINUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
VWWQXMAJTJZDQX-UYBVJOGSSA-N
SMILES
Cc1cc2c(cc1C)N(C3=NC(=O)NC(=O)C3=N2)CC(C(C(COP(=O)(O)OP(=O)(O)OCC4C(C(C(O4)n5cnc6c5ncnc6N)O)O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5X1Y
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5x1yA1e5x1yA2e5x1yA3e5x1yB1e5x1yB2e5x1yB3e5x1yC1e5x1yC2e5x1yC3e5x1yD1e5x1yD2e5x1yD3e5x1yE1e5x1yE2e5x1yE3e5x1yF1e5x1yF2e5x1yF3
ECOD domains from experimental PDB structures interacting with ligand DB03147
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| D9J041 | DB03147 | FAD | 5x1y | e5x1yA1 | A:420-535 |
| D9J041 | DB03147 | FAD | 5x1y | e5x1yA2 | A:83-228,A:345-419 |
| D9J041 | DB03147 | FAD | 5x1y | e5x1yA3 | A:229-344 |
| D9J041 | DB03147 | FAD | 5x1y | e5x1yB1 | B:227-345 |
| D9J041 | DB03147 | FAD | 5x1y | e5x1yB2 | B:419-535 |
| D9J041 | DB03147 | FAD | 5x1y | e5x1yB3 | B:82-226,B:346-418 |
| D9J041 | DB03147 | FAD | 5x1y | e5x1yC1 | C:83-228,C:345-419 |
| D9J041 | DB03147 | FAD | 5x1y | e5x1yC2 | C:229-344 |
| D9J041 | DB03147 | FAD | 5x1y | e5x1yC3 | C:420-535 |
| D9J041 | DB03147 | FAD | 5x1y | e5x1yD1 | D:229-344 |
| D9J041 | DB03147 | FAD | 5x1y | e5x1yD2 | D:420-535 |
| D9J041 | DB03147 | FAD | 5x1y | e5x1yD3 | D:83-228,D:345-419 |
| D9J041 | DB03147 | FAD | 5x1y | e5x1yE1 | E:420-535 |
| D9J041 | DB03147 | FAD | 5x1y | e5x1yE2 | E:229-344 |
| D9J041 | DB03147 | FAD | 5x1y | e5x1yE3 | E:83-228,E:345-419 |
| D9J041 | DB03147 | FAD | 5x1y | e5x1yF1 | F:229-344 |
| D9J041 | DB03147 | FAD | 5x1y | e5x1yF2 | F:83-228,F:345-419 |
| D9J041 | DB03147 | FAD | 5x1y | e5x1yF3 | F:420-535 |