Attributes
UniProt ID
Protein Name
Hemagglutinin
Ligand Name
2-acetamido-2-deoxy-beta-D-glucopyranose
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
OVRNDRQMDRJTHS-FMDGEEDCSA-N
SMILES
CC(=O)NC1C(C(C(OC1O)CO)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4UO4
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4uo4A1e4uo4B1
ECOD domains from experimental PDB structures interacting with ligand DB00141
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| E0UVR5 | DB00141 | NAG | 4uo4 | e4uo4A1 | A:8-326 |
| E0UVR5 | DB00141 | NAG | 4uo4 | e4uo4B1 | B:1-175 |
| E0UVR5 | DB00141 | NAG | 4uo5 | e4uo5A1 | A:8-326 |
| E0UVR5 | DB00141 | NAG | 4uo5 | e4uo5B1 | B:1-175 |
| E0UVR5 | DB00141 | NAG | 4uo5 | e4uo5C1 | C:8-326 |
| E0UVR5 | DB00141 | NAG | 4uo5 | e4uo5E1 | E:8-326 |
| E0UVR5 | DB00141 | NAG | 4uo6 | e4uo6A1 | A:8-326 |
| E0UVR5 | DB00141 | NAG | 4uo6 | e4uo6B1 | B:1-175 |
| E0UVR5 | DB00141 | NAG | 4uo7 | e4uo7A1 | A:8-326 |
| E0UVR5 | DB00141 | NAG | 4uo7 | e4uo7C1 | C:8-326 |
| E0UVR5 | DB00141 | NAG | 4uo7 | e4uo7D1 | D:1-175 |
| E0UVR5 | DB00141 | NAG | 4uo7 | e4uo7E1 | E:8-326 |
| E0UVR5 | DB00141 | NAG | 4uo7 | e4uo7F1 | F:1-174 |
| E0UVR5 | DB00141 | NAG | 4uo8 | e4uo8A1 | A:8-326 |
| E0UVR5 | DB00141 | NAG | 4uo8 | e4uo8B1 | B:1-175 |
| E0UVR5 | DB00141 | NAG | 4uo9 | e4uo9A1 | A:8-327 |
| E0UVR5 | DB00141 | NAG | 4uo9 | e4uo9B1 | B:1-174 |
| E0UVR5 | DB00141 | NAG | 4uoa | e4uoaA1 | A:3-326 |
| E0UVR5 | DB00141 | NAG | 4uoa | e4uoaB1 | B:1-172 |