Attributes
UniProt ID
Protein Name
Fructofuranosidase
Ligand Name
2-acetamido-2-deoxy-beta-D-glucopyranose
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
OVRNDRQMDRJTHS-FMDGEEDCSA-N
SMILES
CC(=O)NC1C(C(C(OC1O)CO)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3U14
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3u14A2e3u14A3e3u14B3e3u14B4
ECOD domains from experimental PDB structures interacting with ligand DB00141
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| E5D0X5 | DB00141 | NAG | 3u14 | e3u14A2 | A:369-535 |
| E5D0X5 | DB00141 | NAG | 3u14 | e3u14A3 | A:27-368 |
| E5D0X5 | DB00141 | NAG | 3u14 | e3u14B3 | B:369-535 |
| E5D0X5 | DB00141 | NAG | 3u14 | e3u14B4 | B:27-368 |
| E5D0X5 | DB00141 | NAG | 3u75 | e3u75A4 | A:24-368 |
| E5D0X5 | DB00141 | NAG | 3u75 | e3u75B3 | B:369-535 |
| E5D0X5 | DB00141 | NAG | 3u75 | e3u75B4 | B:24-368 |
| E5D0X5 | DB00141 | NAG | 3u75 | e3u75C3 | C:369-535 |
| E5D0X5 | DB00141 | NAG | 3u75 | e3u75C4 | C:24-368 |
| E5D0X5 | DB00141 | NAG | 3u75 | e3u75D4 | D:24-368 |
| E5D0X5 | DB00141 | NAG | 6s1t | e6s1tA1 | A:24-368 |
| E5D0X5 | DB00141 | NAG | 6s1t | e6s1tA2 | A:369-535 |
| E5D0X5 | DB00141 | NAG | 6s1t | e6s1tB1 | B:24-368 |
| E5D0X5 | DB00141 | NAG | 6s1t | e6s1tB2 | B:369-535 |
| E5D0X5 | DB00141 | NAG | 6s2b | e6s2bA1 | A:369-535 |
| E5D0X5 | DB00141 | NAG | 6s2b | e6s2bA2 | A:24-368 |
| E5D0X5 | DB00141 | NAG | 6s2b | e6s2bB1 | B:24-368 |