Attributes
UniProt ID
Protein Name
TqaA
Ligand Name
4'-PHOSPHOPANTETHEINE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
JDMUPRLRUUMCTL-VIFPVBQESA-N
SMILES
CC(C)(COP(=O)(O)O)C(C(=O)NCCC(=O)NCCS)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5EJD
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5ejdA1e5ejdB1e5ejdB2e5ejdC1e5ejdD1e5ejdD2e5ejdE1e5ejdF1e5ejdF2e5ejdG1e5ejdH1e5ejdH2e5ejdI1e5ejdJ1e5ejdJ2e5ejdK1e5ejdL1e5ejdL2e5ejdM1e5ejdN1e5ejdN2e5ejdO1e5ejdP1e5ejdP2
ECOD domains from experimental PDB structures interacting with ligand DB03912
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| F1CWE4 | DB03912 | PNS | 5ejd | e5ejdA1 | A:2-76 |
| F1CWE4 | DB03912 | PNS | 5ejd | e5ejdB1 | B:20-220 |
| F1CWE4 | DB03912 | PNS | 5ejd | e5ejdB2 | B:221-484 |
| F1CWE4 | DB03912 | PNS | 5ejd | e5ejdC1 | C:2-75 |
| F1CWE4 | DB03912 | PNS | 5ejd | e5ejdD1 | D:221-484 |
| F1CWE4 | DB03912 | PNS | 5ejd | e5ejdD2 | D:20-220 |
| F1CWE4 | DB03912 | PNS | 5ejd | e5ejdE1 | E:3-74 |
| F1CWE4 | DB03912 | PNS | 5ejd | e5ejdF1 | F:20-220 |
| F1CWE4 | DB03912 | PNS | 5ejd | e5ejdF2 | F:221-483 |
| F1CWE4 | DB03912 | PNS | 5ejd | e5ejdG1 | G:2-76 |
| F1CWE4 | DB03912 | PNS | 5ejd | e5ejdH1 | H:221-483 |
| F1CWE4 | DB03912 | PNS | 5ejd | e5ejdH2 | H:20-220 |
| F1CWE4 | DB03912 | PNS | 5ejd | e5ejdI1 | I:3-74 |
| F1CWE4 | DB03912 | PNS | 5ejd | e5ejdJ1 | J:221-484 |
| F1CWE4 | DB03912 | PNS | 5ejd | e5ejdJ2 | J:20-220 |
| F1CWE4 | DB03912 | PNS | 5ejd | e5ejdK1 | K:4-76 |
| F1CWE4 | DB03912 | PNS | 5ejd | e5ejdL1 | L:20-220 |
| F1CWE4 | DB03912 | PNS | 5ejd | e5ejdL2 | L:221-483 |
| F1CWE4 | DB03912 | PNS | 5ejd | e5ejdM1 | M:4-73 |
| F1CWE4 | DB03912 | PNS | 5ejd | e5ejdN1 | N:20-220 |
| F1CWE4 | DB03912 | PNS | 5ejd | e5ejdN2 | N:221-483 |
| F1CWE4 | DB03912 | PNS | 5ejd | e5ejdO1 | O:3-76 |
| F1CWE4 | DB03912 | PNS | 5ejd | e5ejdP1 | P:221-484 |
| F1CWE4 | DB03912 | PNS | 5ejd | e5ejdP2 | P:20-220 |