Attributes
UniProt ID
Protein Name
deleted
Ligand Name
GUANOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XKMLYUALXHKNFT-UUOKFMHZSA-N
SMILES
c1nc2c(n1C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N=C(NC2=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3J8X
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3j8xA1e3j8xA2e3j8xB1e3j8xB2e3j8xK1
ECOD domains from experimental PDB structures interacting with ligand DB04137
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| F2Z5B2 | DB04137 | GTP | 3j8x | e3j8xB1 | B:246-441 |
| F2Z5B2 | DB04137 | GTP | 3j8y | e3j8yB1 | B:246-441 |
| F2Z5B2 | DB04137 | GTP | 5ca0 | e5ca0B1 | B:244-428 |
| F2Z5B2 | DB04137 | GTP | 5ca0 | e5ca0D2 | D:244-431 |
| F2Z5B2 | DB04137 | GTP | 5jcb | e5jcbB2 | B:246-438 |
| F2Z5B2 | DB04137 | GTP | 5jcb | e5jcbD2 | D:246-441 |
| F2Z5B2 | DB04137 | GTP | 5xke | e5xkeB1 | B:244-428 |
| F2Z5B2 | DB04137 | GTP | 5xke | e5xkeD1 | D:244-431 |
| F2Z5B2 | DB04137 | GTP | 5xke | e5xkeD2 | D:1-243 |
| F2Z5B2 | DB04137 | GTP | 5xkh | e5xkhB2 | B:244-428 |
| F2Z5B2 | DB04137 | GTP | 5xkh | e5xkhD1 | D:1-243 |
| F2Z5B2 | DB04137 | GTP | 5xkh | e5xkhD2 | D:244-431 |
| F2Z5B2 | DB04137 | GTP | 5xp3 | e5xp3B1 | B:244-428 |
| F2Z5B2 | DB04137 | GTP | 5xp3 | e5xp3D1 | D:1-243 |
| F2Z5B2 | DB04137 | GTP | 5xp3 | e5xp3D2 | D:244-431 |
| F2Z5B2 | DB04137 | GTP | 6b0c | e6b0cB1 | B:244-425 |
| F2Z5B2 | DB04137 | GTP | 6b0c | e6b0cD1 | D:244-429 |
| F2Z5B2 | DB04137 | GTP | 6b0i | e6b0iB2 | B:244-429 |
| F2Z5B2 | DB04137 | GTP | 6b0l | e6b0lB2 | B:244-429 |