Attributes
UniProt ID
Protein Name
ATP synthase subunit beta
Ligand Name
ADENOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XTWYTFMLZFPYCI-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5HKK
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5hkkA1e5hkkA2e5hkkA3e5hkkB1e5hkkB2e5hkkB3e5hkkC1e5hkkC2e5hkkC3e5hkkD1e5hkkD2e5hkkD3e5hkkE1e5hkkE2e5hkkE3e5hkkF1e5hkkF2e5hkkF3e5hkkG1e5hkkH1e5hkkH2e5hkkI1e5hkkI2e5hkkI3e5hkkJ1e5hkkJ2e5hkkJ3e5hkkK1e5hkkK2e5hkkK3e5hkkL1e5hkkL2e5hkkL3e5hkkM1e5hkkM2e5hkkM3e5hkkN1e5hkkN2e5hkkN3e5hkkO1e5hkkP1e5hkkP2
ECOD domains from experimental PDB structures interacting with ligand DB16833
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| F5LA72 | DB16833 | ADP | 5hkk | e5hkkD2 | D:77-346 |
| F5LA72 | DB16833 | ADP | 5hkk | e5hkkD3 | D:347-462 |
| F5LA72 | DB16833 | ADP | 5hkk | e5hkkE1 | E:77-346 |
| F5LA72 | DB16833 | ADP | 5hkk | e5hkkE3 | E:347-462 |
| F5LA72 | DB16833 | ADP | 5hkk | e5hkkF1 | F:77-346 |
| F5LA72 | DB16833 | ADP | 5hkk | e5hkkF3 | F:347-462 |
| F5LA72 | DB16833 | ADP | 5hkk | e5hkkL1 | L:77-346 |
| F5LA72 | DB16833 | ADP | 5hkk | e5hkkL3 | L:347-462 |
| F5LA72 | DB16833 | ADP | 5hkk | e5hkkM1 | M:77-346 |
| F5LA72 | DB16833 | ADP | 5hkk | e5hkkM2 | M:347-462 |
| F5LA72 | DB16833 | ADP | 5hkk | e5hkkN1 | N:347-462 |
| F5LA72 | DB16833 | ADP | 5hkk | e5hkkN2 | N:77-346 |
| F5LA72 | DB16833 | ADP | 5ik2 | e5ik2D1 | D:77-346 |
| F5LA72 | DB16833 | ADP | 5ik2 | e5ik2D2 | D:347-462 |
| F5LA72 | DB16833 | ADP | 5ik2 | e5ik2E2 | E:347-462 |
| F5LA72 | DB16833 | ADP | 5ik2 | e5ik2E3 | E:77-346 |
| F5LA72 | DB16833 | ADP | 5ik2 | e5ik2F2 | F:77-346 |
| F5LA72 | DB16833 | ADP | 5ik2 | e5ik2F3 | F:347-462 |
| F5LA72 | DB16833 | ADP | 5ik2 | e5ik2L1 | L:347-462 |
| F5LA72 | DB16833 | ADP | 5ik2 | e5ik2L2 | L:77-346 |
| F5LA72 | DB16833 | ADP | 5ik2 | e5ik2M1 | M:347-462 |
| F5LA72 | DB16833 | ADP | 5ik2 | e5ik2M2 | M:77-346 |
| F5LA72 | DB16833 | ADP | 5ik2 | e5ik2N2 | N:347-462 |
| F5LA72 | DB16833 | ADP | 5ik2 | e5ik2N3 | N:77-346 |