Attributes
UniProt ID
Protein Name
Cytochrome P460
Ligand Name
HEME C
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
HXQIYSLZKNYNMH-LJNAALQVSA-N
SMILES
CC=C1C(=C2C=C3C(=CC)C(=C4N3[Fe]56N2C1=Cc7n5c(c(c7C)CCC(=O)O)C=C8N6C(=C4)C(=C8CCC(=O)O)C)C)C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6AMG
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6amgA1e6amgB1
ECOD domains from experimental PDB structures interacting with ligand DB03317
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| F9ZFJ0 | DB03317 | HEC | 6amg | e6amgA1 | A:37-194 |
| F9ZFJ0 | DB03317 | HEC | 6amg | e6amgB1 | B:35-194 |
| F9ZFJ0 | DB03317 | HEC | 6e0x | e6e0xA1 | A:35-194 |
| F9ZFJ0 | DB03317 | HEC | 6e0x | e6e0xB1 | B:35-195 |
| F9ZFJ0 | DB03317 | HEC | 6e0x | e6e0xC1 | C:37-195 |
| F9ZFJ0 | DB03317 | HEC | 6e0x | e6e0xD1 | D:37-195 |
| F9ZFJ0 | DB03317 | HEC | 6e0y | e6e0yA1 | A:35-195 |
| F9ZFJ0 | DB03317 | HEC | 6e0y | e6e0yB1 | B:36-194 |
| F9ZFJ0 | DB03317 | HEC | 6e0y | e6e0yC1 | C:36-194 |
| F9ZFJ0 | DB03317 | HEC | 6e0y | e6e0yD1 | D:35-195 |
| F9ZFJ0 | DB03317 | HEC | 6e0z | e6e0zA1 | A:37-195 |
| F9ZFJ0 | DB03317 | HEC | 6e0z | e6e0zB1 | B:35-195 |
| F9ZFJ0 | DB03317 | HEC | 6e0z | e6e0zC1 | C:37-194 |
| F9ZFJ0 | DB03317 | HEC | 6e0z | e6e0zD1 | D:35-195 |
| F9ZFJ0 | DB03317 | HEC | 6e17 | e6e17A1 | A:38-194 |
| F9ZFJ0 | DB03317 | HEC | 6e17 | e6e17B1 | B:37-194 |
| F9ZFJ0 | DB03317 | HEC | 6e17 | e6e17C1 | C:37-194 |
| F9ZFJ0 | DB03317 | HEC | 6e17 | e6e17D1 | D:38-194 |
| F9ZFJ0 | DB03317 | HEC | 6w6n | e6w6nA1 | A:37-194 |
| F9ZFJ0 | DB03317 | HEC | 6w6n | e6w6nB1 | B:35-194 |