Attributes
UniProt ID
Protein Name
PAN2-PAN3 deadenylation complex subunit PAN3 -specific ribonuclease) -nuclease deadenylation complex subunit 3
Ligand Name
ADENOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZKHQWZAMYRWXGA-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4CYI
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4cyiA1e4cyiB2e4cyiC1e4cyiD1e4cyiD2e4cyiE2e4cyiF2e4cyiG1e4cyiH2
ECOD domains from experimental PDB structures interacting with ligand DB00171
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| G0S0Y3 | DB00171 | ATP | 4cyi | e4cyiA1 | A:215-485 |
| G0S0Y3 | DB00171 | ATP | 4cyi | e4cyiB2 | B:213-485 |
| G0S0Y3 | DB00171 | ATP | 4cyi | e4cyiC1 | C:215-485 |
| G0S0Y3 | DB00171 | ATP | 4cyi | e4cyiD1 | D:214-497 |
| G0S0Y3 | DB00171 | ATP | 4cyi | e4cyiE2 | E:215-485 |
| G0S0Y3 | DB00171 | ATP | 4cyi | e4cyiF2 | F:213-485 |
| G0S0Y3 | DB00171 | ATP | 4cyi | e4cyiG1 | G:212-485 |
| G0S0Y3 | DB00171 | ATP | 4cyi | e4cyiH2 | H:215-485 |
| G0S0Y3 | DB00171 | ATP | 4cyj | e4cyjA2 | A:207-485 |
| G0S0Y3 | DB00171 | ATP | 4cyj | e4cyjB2 | B:207-485 |
| G0S0Y3 | DB00171 | ATP | 4cyj | e4cyjC2 | C:210-485 |
| G0S0Y3 | DB00171 | ATP | 4cyj | e4cyjD2 | D:207-485 |