Attributes
UniProt ID
Protein Name
Trehalose-6-phosphate synthase
Ligand Name
URIDINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XCCTYIAWTASOJW-XVFCMESISA-N
SMILES
C1=CN(C(=O)NC1=O)C2C(C(C(O2)COP(=O)(O)OP(=O)(O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6JBR
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6jbrA1e6jbrA2e6jbrB1e6jbrB2e6jbrD1e6jbrD2e6jbrF1e6jbrF2e6jbrH1e6jbrH2e6jbrK1e6jbrK2e6jbrM1e6jbrM2e6jbrO1e6jbrO2
ECOD domains from experimental PDB structures interacting with ligand DB03435
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| G4NHF4 | DB03435 | UDP | 6jbr | e6jbrA1 | A:251-479 |
| G4NHF4 | DB03435 | UDP | 6jbr | e6jbrA2 | A:15-250 |
| G4NHF4 | DB03435 | UDP | 6jbr | e6jbrB1 | B:15-250 |
| G4NHF4 | DB03435 | UDP | 6jbr | e6jbrB2 | B:251-479 |
| G4NHF4 | DB03435 | UDP | 6jbr | e6jbrD1 | D:15-250 |
| G4NHF4 | DB03435 | UDP | 6jbr | e6jbrD2 | D:251-479 |
| G4NHF4 | DB03435 | UDP | 6jbr | e6jbrF1 | F:15-250 |
| G4NHF4 | DB03435 | UDP | 6jbr | e6jbrF2 | F:251-479 |
| G4NHF4 | DB03435 | UDP | 6jbr | e6jbrH1 | H:251-479 |
| G4NHF4 | DB03435 | UDP | 6jbr | e6jbrH2 | H:15-250 |
| G4NHF4 | DB03435 | UDP | 6jbr | e6jbrK1 | K:15-250 |
| G4NHF4 | DB03435 | UDP | 6jbr | e6jbrK2 | K:251-479 |
| G4NHF4 | DB03435 | UDP | 6jbr | e6jbrM1 | M:15-250 |
| G4NHF4 | DB03435 | UDP | 6jbr | e6jbrM2 | M:251-479 |
| G4NHF4 | DB03435 | UDP | 6jbr | e6jbrO1 | O:251-479 |
| G4NHF4 | DB03435 | UDP | 6jbr | e6jbrO2 | O:15-250 |
| G4NHF4 | DB03435 | UDP | 6jbw | e6jbwA1 | A:15-250 |
| G4NHF4 | DB03435 | UDP | 6jbw | e6jbwA2 | A:251-479 |
| G4NHF4 | DB03435 | UDP | 6jbw | e6jbwB1 | B:15-250 |
| G4NHF4 | DB03435 | UDP | 6jbw | e6jbwB2 | B:251-479 |