Attributes
UniProt ID
Protein Name
Sulfotransferase oxamniquine resistance protein
Ligand Name
ADENOSINE-3'-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
WHTCPDAXWFLDIH-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)O)OP(=O)(O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4MUA
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4muaA1
ECOD domains from experimental PDB structures interacting with ligand DB01812
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| G4VLE5 | DB01812 | A3P | 4mua | e4muaA1 | A:-1-257 |
| G4VLE5 | DB01812 | A3P | 4mub | e4mubA1 | A:-1-257 |
| G4VLE5 | DB01812 | A3P | 5byj | e5byjA1 | A:-1-257 |
| G4VLE5 | DB01812 | A3P | 5byk | e5bykA1 | A:-1-257 |
| G4VLE5 | DB01812 | A3P | 6b4x | e6b4xA1 | A:-1-256 |
| G4VLE5 | DB01812 | A3P | 6b4y | e6b4yA1 | A:-1-256 |
| G4VLE5 | DB01812 | A3P | 6b4z | e6b4zA1 | A:-1-257 |
| G4VLE5 | DB01812 | A3P | 6b50 | e6b50A1 | A:-1-257 |
| G4VLE5 | DB01812 | A3P | 6bdp | e6bdpA1 | A:-1-257 |
| G4VLE5 | DB01812 | A3P | 6bdq | e6bdqA1 | A:-1-257 |
| G4VLE5 | DB01812 | A3P | 6bdr | e6bdrA1 | A:-1-257 |
| G4VLE5 | DB01812 | A3P | 6bds | e6bdsA1 | A:-1-256 |
| G4VLE5 | DB01812 | A3P | 6mfe | e6mfeA1 | A:-1-257 |
| G4VLE5 | DB01812 | A3P | 6uux | e6uuxA1 | A:-1-257 |
| G4VLE5 | DB01812 | A3P | 8e5q | e8e5qA1 | A:7-256 |
| G4VLE5 | DB01812 | A3P | 8e5r | e8e5rA1 | A:-1-256 |