Attributes
UniProt ID
Protein Name
Neuraminidase
Ligand Name
2-acetamido-2-deoxy-beta-D-glucopyranose
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
OVRNDRQMDRJTHS-FMDGEEDCSA-N
SMILES
CC(=O)NC1C(C(C(OC1O)CO)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4GDI
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4gdiA1e4gdiB1e4gdiC1e4gdiD1e4gdiE1e4gdiF1
ECOD domains from experimental PDB structures interacting with ligand DB00141
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| H6QM85 | DB00141 | NAG | 4gdi | e4gdiA1 | A:77-447 |
| H6QM85 | DB00141 | NAG | 4gdi | e4gdiB1 | B:77-447 |
| H6QM85 | DB00141 | NAG | 4gdi | e4gdiC1 | C:77-447 |
| H6QM85 | DB00141 | NAG | 4gdi | e4gdiD1 | D:77-447 |
| H6QM85 | DB00141 | NAG | 4gdi | e4gdiE1 | E:77-447 |
| H6QM85 | DB00141 | NAG | 4gdi | e4gdiF1 | F:77-447 |
| H6QM85 | DB00141 | NAG | 4gez | e4gezA1 | A:77-441 |
| H6QM85 | DB00141 | NAG | 4gez | e4gezB1 | B:65-429 |
| H6QM85 | DB00141 | NAG | 4gez | e4gezC1 | C:65-429 |
| H6QM85 | DB00141 | NAG | 4gez | e4gezD1 | D:65-429 |
| H6QM85 | DB00141 | NAG | 4gez | e4gezE1 | E:65-429 |
| H6QM85 | DB00141 | NAG | 4gez | e4gezF1 | F:65-429 |
| H6QM85 | DB00141 | NAG | 4gez | e4gezG1 | G:65-429 |
| H6QM85 | DB00141 | NAG | 4gez | e4gezH1 | H:65-429 |
| H6QM85 | DB00141 | NAG | 4gez | e4gezI1 | I:65-429 |
| H6QM85 | DB00141 | NAG | 4gez | e4gezJ1 | J:65-429 |
| H6QM85 | DB00141 | NAG | 4gez | e4gezK1 | K:65-429 |
| H6QM85 | DB00141 | NAG | 4gez | e4gezL1 | L:65-429 |