Attributes
UniProt ID
Protein Name
3-sulfinopropanoyl-CoA desulfinase
Ligand Name
FLAVIN-ADENINE DINUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
VWWQXMAJTJZDQX-UYBVJOGSSA-N
SMILES
Cc1cc2c(cc1C)N(C3=NC(=O)NC(=O)C3=N2)CC(C(C(COP(=O)(O)OP(=O)(O)OCC4C(C(C(O4)n5cnc6c5ncnc6N)O)O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5AF7
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5af7A1e5af7A2e5af7A3e5af7B1e5af7B2e5af7B3
ECOD domains from experimental PDB structures interacting with ligand DB03147
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| K4L7X3 | DB03147 | FAD | 5af7 | e5af7A1 | A:3-117 |
| K4L7X3 | DB03147 | FAD | 5af7 | e5af7A2 | A:234-392 |
| K4L7X3 | DB03147 | FAD | 5af7 | e5af7A3 | A:118-233 |
| K4L7X3 | DB03147 | FAD | 5af7 | e5af7B1 | B:118-233 |
| K4L7X3 | DB03147 | FAD | 5af7 | e5af7B2 | B:234-393 |
| K4L7X3 | DB03147 | FAD | 5af7 | e5af7B3 | B:3-117 |
| K4L7X3 | DB03147 | FAD | 5ahs | e5ahsA1 | A:118-233 |
| K4L7X3 | DB03147 | FAD | 5ahs | e5ahsA2 | A:234-392 |
| K4L7X3 | DB03147 | FAD | 5ahs | e5ahsA3 | A:2-117 |
| K4L7X3 | DB03147 | FAD | 5ahs | e5ahsB1 | B:118-233 |
| K4L7X3 | DB03147 | FAD | 5ahs | e5ahsB2 | B:234-392 |
| K4L7X3 | DB03147 | FAD | 5ahs | e5ahsB3 | B:2-117 |
| K4L7X3 | DB03147 | FAD | 5ahs | e5ahsC1 | C:118-233 |
| K4L7X3 | DB03147 | FAD | 5ahs | e5ahsC2 | C:234-392 |
| K4L7X3 | DB03147 | FAD | 5ahs | e5ahsC3 | C:2-117 |
| K4L7X3 | DB03147 | FAD | 5ahs | e5ahsD1 | D:234-392 |
| K4L7X3 | DB03147 | FAD | 5ahs | e5ahsD2 | D:3-117 |
| K4L7X3 | DB03147 | FAD | 5ahs | e5ahsD3 | D:118-233 |
| K4L7X3 | DB03147 | FAD | 5ahs | e5ahsE1 | E:118-233 |
| K4L7X3 | DB03147 | FAD | 5ahs | e5ahsE2 | E:2-117 |
| K4L7X3 | DB03147 | FAD | 5ahs | e5ahsE3 | E:234-392 |
| K4L7X3 | DB03147 | FAD | 5ahs | e5ahsF1 | F:118-233 |
| K4L7X3 | DB03147 | FAD | 5ahs | e5ahsF2 | F:2-117 |
| K4L7X3 | DB03147 | FAD | 5ahs | e5ahsF3 | F:234-392 |