Attributes
UniProt ID
Protein Name
Hemagglutinin-esterase-fusion glycoprotein
Ligand Name
2-acetamido-2-deoxy-beta-D-glucopyranose
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
OVRNDRQMDRJTHS-FMDGEEDCSA-N
SMILES
CC(=O)NC1C(C(C(OC1O)CO)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5E5W
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5e5wA1e5e5wA2e5e5wB1e5e5wC1e5e5wC2e5e5wD1
ECOD domains from experimental PDB structures interacting with ligand DB00141
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| K9LG83 | DB00141 | NAG | 5e5w | e5e5wA1 | A:3-150,A:311-429 |
| K9LG83 | DB00141 | NAG | 5e5w | e5e5wB1 | B:9-157 |
| K9LG83 | DB00141 | NAG | 5e5w | e5e5wC2 | C:3-150,C:311-429 |
| K9LG83 | DB00141 | NAG | 5e5w | e5e5wD1 | D:9-157 |
| K9LG83 | DB00141 | NAG | 5e62 | e5e62A2 | A:3-150,A:311-429 |
| K9LG83 | DB00141 | NAG | 5e62 | e5e62B1 | B:9-157 |
| K9LG83 | DB00141 | NAG | 5e62 | e5e62C1 | C:3-150,C:311-429 |
| K9LG83 | DB00141 | NAG | 5e62 | e5e62D1 | D:9-157 |
| K9LG83 | DB00141 | NAG | 5e64 | e5e64A2 | A:3-150,A:311-429 |
| K9LG83 | DB00141 | NAG | 5e64 | e5e64B1 | B:9-157 |
| K9LG83 | DB00141 | NAG | 5e64 | e5e64C1 | C:3-150,C:311-429 |
| K9LG83 | DB00141 | NAG | 5e64 | e5e64D1 | D:9-157 |
| K9LG83 | DB00141 | NAG | 5e65 | e5e65A1 | A:3-150,A:311-429 |
| K9LG83 | DB00141 | NAG | 5e65 | e5e65B1 | B:9-157 |
| K9LG83 | DB00141 | NAG | 5e65 | e5e65C2 | C:3-150,C:311-429 |
| K9LG83 | DB00141 | NAG | 5e65 | e5e65D1 | D:9-157 |
| K9LG83 | DB00141 | NAG | 5e66 | e5e66A2 | A:3-150,A:311-429 |
| K9LG83 | DB00141 | NAG | 5e66 | e5e66B1 | B:9-157 |