Attributes
UniProt ID
Protein Name
Obtusifoliol 14alphademethylase, putative
Ligand Name
PROTOPORPHYRIN IX CONTAINING FE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
KABFMIBPWCXCRK-RGGAHWMASA-L
SMILES
Cc1c2n3c(c1CCC(=O)O)C=C4C(=C(C5=[N]4[Fe]36[N]7=C(C=C8N6C(=C5)C(=C8C)C=C)C(=C(C7=C2)C)C=C)C)CCC(=O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6Q2C
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6q2cA1e6q2cB1
ECOD domains from experimental PDB structures interacting with ligand DB18267
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| L8GJB3 | DB18267 | HEM | 6q2c | e6q2cA1 | A:40-488 |
| L8GJB3 | DB18267 | HEM | 6q2c | e6q2cB1 | B:39-487 |
| L8GJB3 | DB18267 | HEM | 6uw2 | e6uw2A1 | A:40-488 |
| L8GJB3 | DB18267 | HEM | 6uw2 | e6uw2B1 | B:41-487 |
| L8GJB3 | DB18267 | HEM | 6uw2 | e6uw2C1 | C:41-486 |
| L8GJB3 | DB18267 | HEM | 6uw2 | e6uw2D1 | D:41-487 |
| L8GJB3 | DB18267 | HEM | 6uw2 | e6uw2E1 | E:41-488 |
| L8GJB3 | DB18267 | HEM | 6uw2 | e6uw2F1 | F:40-487 |
| L8GJB3 | DB18267 | HEM | 6ux0 | e6ux0A1 | A:74-486 |
| L8GJB3 | DB18267 | HEM | 6ux0 | e6ux0B1 | B:74-487 |
| L8GJB3 | DB18267 | HEM | 6ux0 | e6ux0C1 | C:74-487 |
| L8GJB3 | DB18267 | HEM | 6ux0 | e6ux0D1 | D:74-487 |
| L8GJB3 | DB18267 | HEM | 6ux0 | e6ux0E1 | E:75-487 |
| L8GJB3 | DB18267 | HEM | 6ux0 | e6ux0F1 | F:75-487 |
| L8GJB3 | DB18267 | HEM | 7les | e7lesA1 | A:40-488 |
| L8GJB3 | DB18267 | HEM | 7les | e7lesB1 | B:40-487 |
| L8GJB3 | DB18267 | HEM | 7les | e7lesC1 | C:40-488 |
| L8GJB3 | DB18267 | HEM | 7les | e7lesD1 | D:41-487 |
| L8GJB3 | DB18267 | HEM | 7uwp | e7uwpA1 | A:43-486 |
| L8GJB3 | DB18267 | HEM | 7uwp | e7uwpB1 | B:43-486 |
| L8GJB3 | DB18267 | HEM | 8ekt | e8ektA1 | A:74-486 |
| L8GJB3 | DB18267 | HEM | 8ekt | e8ektB1 | B:74-486 |
| L8GJB3 | DB18267 | HEM | 8ekt | e8ektC1 | C:74-486 |
| L8GJB3 | DB18267 | HEM | 8ekt | e8ektD1 | D:74-486 |
| L8GJB3 | DB18267 | HEM | 8ekt | e8ektE1 | E:74-486 |
| L8GJB3 | DB18267 | HEM | 8ekt | e8ektF1 | F:74-486 |