Attributes
UniProt ID
Protein Name
Terminal uridylyltransferase cid1 polymerase cid1) polymerase cid1
Ligand Name
URIDINE 5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
PGAVKCOVUIYSFO-XVFCMESISA-N
SMILES
C1=CN(C(=O)NC1=O)C2C(C(C(O2)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4E80
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4e80A5e4e80A6e4e80B5e4e80B6e4e80C5e4e80C6e4e80D5e4e80D6
ECOD domains from experimental PDB structures interacting with ligand DB04005
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| O13833 | DB04005 | UTP | 4e80 | e4e80A5 | A:163-379 |
| O13833 | DB04005 | UTP | 4e80 | e4e80A6 | A:41-162 |
| O13833 | DB04005 | UTP | 4e80 | e4e80B5 | B:163-379 |
| O13833 | DB04005 | UTP | 4e80 | e4e80B6 | B:41-162 |
| O13833 | DB04005 | UTP | 4e80 | e4e80C5 | C:164-381 |
| O13833 | DB04005 | UTP | 4e80 | e4e80C6 | C:42-163 |
| O13833 | DB04005 | UTP | 4e80 | e4e80D5 | D:163-380 |
| O13833 | DB04005 | UTP | 4e80 | e4e80D6 | D:41-162 |
| O13833 | DB04005 | UTP | 4ep7 | e4ep7A1 | A:187-377 |
| O13833 | DB04005 | UTP | 4ep7 | e4ep7A2 | A:38-186 |
| O13833 | DB04005 | UTP | 4ep7 | e4ep7B7 | B:187-377 |
| O13833 | DB04005 | UTP | 4ep7 | e4ep7B8 | B:39-186 |
| O13833 | DB04005 | UTP | 4fh5 | e4fh5A7 | A:187-377 |
| O13833 | DB04005 | UTP | 4fh5 | e4fh5A8 | A:40-186 |
| O13833 | DB04005 | UTP | 4fhp | e4fhpA7 | A:187-377 |
| O13833 | DB04005 | UTP | 4fhp | e4fhpA8 | A:40-186 |