Attributes
UniProt ID
Protein Name
Prostaglandin E synthase
Ligand Name
GLUTATHIONE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
RWSXRVCMGQZWBV-WDSKDSINSA-N
SMILES
C(CC(=O)NC(CS)C(=O)NCC(=O)O)C(C(=O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3DWW
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3dwwA1e3dwwB1e3dwwC1
ECOD domains from experimental PDB structures interacting with ligand DB00143
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| O14684 | DB00143 | GSH | 3dww | e3dwwA1 | A:10-152 |
| O14684 | DB00143 | GSH | 3dww | e3dwwB1 | B:11-152 |
| O14684 | DB00143 | GSH | 3dww | e3dwwC1 | C:11-152 |
| O14684 | DB00143 | GSH | 4al0 | e4al0A1 | A:7-152 |
| O14684 | DB00143 | GSH | 4bpm | e4bpmA1 | A:10-171 |
| O14684 | DB00143 | GSH | 4wab | e4wabA1 | A:10-170 |
| O14684 | DB00143 | GSH | 4yk5 | e4yk5A1 | A:7-152 |
| O14684 | DB00143 | GSH | 4yl0 | e4yl0A1 | A:5-152 |
| O14684 | DB00143 | GSH | 4yl1 | e4yl1A1 | A:5-152 |
| O14684 | DB00143 | GSH | 4yl3 | e4yl3A1 | A:7-152 |
| O14684 | DB00143 | GSH | 5bqg | e5bqgA1 | A:5-152 |
| O14684 | DB00143 | GSH | 5bqh | e5bqhA1 | A:5-152 |
| O14684 | DB00143 | GSH | 5bqi | e5bqiA1 | A:5-152 |
| O14684 | DB00143 | GSH | 5k0i | e5k0iA1 | A:5-152 |
| O14684 | DB00143 | GSH | 5t36 | e5t36A1 | A:6-152 |
| O14684 | DB00143 | GSH | 5t37 | e5t37A1 | A:5-152 |
| O14684 | DB00143 | GSH | 5tl9 | e5tl9A1 | A:5-152 |