Attributes
UniProt ID
Protein Name
Apoptotic protease-activating factor 1
Ligand Name
ADENOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZKHQWZAMYRWXGA-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3J2T
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3j2tA1e3j2tA4e3j2tA5e3j2tA6e3j2tA7e3j2tA8e3j2tB2e3j2tB3e3j2tB4e3j2tB5e3j2tB6e3j2tB7e3j2tC2e3j2tC3e3j2tC4e3j2tC5e3j2tC6e3j2tC7e3j2tD1e3j2tD3e3j2tD5e3j2tD6e3j2tD7e3j2tD8e3j2tE1e3j2tE2e3j2tE3e3j2tE5e3j2tE6e3j2tE7e3j2tF2e3j2tF4e3j2tF5e3j2tF6e3j2tF7e3j2tF8e3j2tG1e3j2tG2e3j2tG5e3j2tG6e3j2tG7e3j2tG8e3j2tH1e3j2tI1e3j2tJ1e3j2tK1e3j2tL1e3j2tM1e3j2tN1
ECOD domains from experimental PDB structures interacting with ligand DB00171
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| O14727 | DB00171 | ATP | 3j2t | e3j2tA4 | A:285-374 |
| O14727 | DB00171 | ATP | 3j2t | e3j2tA5 | A:105-284 |
| O14727 | DB00171 | ATP | 3j2t | e3j2tB2 | B:285-374 |
| O14727 | DB00171 | ATP | 3j2t | e3j2tB3 | B:105-284 |
| O14727 | DB00171 | ATP | 3j2t | e3j2tC2 | C:285-374 |
| O14727 | DB00171 | ATP | 3j2t | e3j2tC6 | C:105-284 |
| O14727 | DB00171 | ATP | 3j2t | e3j2tD5 | D:285-374 |
| O14727 | DB00171 | ATP | 3j2t | e3j2tD6 | D:105-284 |
| O14727 | DB00171 | ATP | 3j2t | e3j2tE3 | E:105-284 |
| O14727 | DB00171 | ATP | 3j2t | e3j2tE5 | E:285-374 |
| O14727 | DB00171 | ATP | 3j2t | e3j2tF4 | F:285-374 |
| O14727 | DB00171 | ATP | 3j2t | e3j2tF6 | F:105-284 |
| O14727 | DB00171 | ATP | 3j2t | e3j2tG2 | G:105-284 |
| O14727 | DB00171 | ATP | 3j2t | e3j2tG6 | G:285-374 |