Attributes
UniProt ID
Protein Name
Glutathione S-transferase A4
Ligand Name
GAMMA-GLUTAMYL[S-(2-IODOBENZYL)CYSTEINYL]GLYCINE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
QFYJAEOZTBVJQM-STQMWFEESA-N
SMILES
c1ccc(c(c1)CSCC(C(=O)NCC(=O)O)NC(=O)CCC(C(=O)O)N)I
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1GUL
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1gulA1e1gulA2e1gulB1e1gulB2e1gulC1e1gulC2e1gulD1e1gulD2e1gulE1e1gulE2e1gulF1e1gulF2e1gulG1e1gulG2e1gulH1e1gulH2
ECOD domains from experimental PDB structures interacting with ligand DB03597
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| O15217 | DB03597 | IBG | 1gul | e1gulA1 | A:81-220 |
| O15217 | DB03597 | IBG | 1gul | e1gulA2 | A:4-80 |
| O15217 | DB03597 | IBG | 1gul | e1gulB1 | B:81-220 |
| O15217 | DB03597 | IBG | 1gul | e1gulB2 | B:4-80 |
| O15217 | DB03597 | IBG | 1gul | e1gulC1 | C:81-220 |
| O15217 | DB03597 | IBG | 1gul | e1gulC2 | C:4-80 |
| O15217 | DB03597 | IBG | 1gul | e1gulD1 | D:81-220 |
| O15217 | DB03597 | IBG | 1gul | e1gulD2 | D:4-80 |
| O15217 | DB03597 | IBG | 1gul | e1gulE1 | E:81-220 |
| O15217 | DB03597 | IBG | 1gul | e1gulE2 | E:4-80 |
| O15217 | DB03597 | IBG | 1gul | e1gulF1 | F:81-220 |
| O15217 | DB03597 | IBG | 1gul | e1gulF2 | F:4-80 |
| O15217 | DB03597 | IBG | 1gul | e1gulG1 | G:81-220 |
| O15217 | DB03597 | IBG | 1gul | e1gulG2 | G:4-80 |
| O15217 | DB03597 | IBG | 1gul | e1gulH1 | H:81-220 |
| O15217 | DB03597 | IBG | 1gul | e1gulH2 | H:4-80 |