Attributes
UniProt ID
Protein Name
3-phosphoinositide-dependent protein kinase 1
Ligand Name
ADENOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZKHQWZAMYRWXGA-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1H1W
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1h1wA1
ECOD domains from experimental PDB structures interacting with ligand DB00171
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| O15530 | DB00171 | ATP | 1h1w | e1h1wA1 | A:73-359 |
| O15530 | DB00171 | ATP | 2biy | e2biyA1 | A:72-359 |
| O15530 | DB00171 | ATP | 3hrc | e3hrcA1 | A:76-359 |
| O15530 | DB00171 | ATP | 3hrf | e3hrfA1 | A:75-359 |
| O15530 | DB00171 | ATP | 4a06 | e4a06A1 | A:75-359 |
| O15530 | DB00171 | ATP | 4a07 | e4a07A1 | A:75-359 |
| O15530 | DB00171 | ATP | 4aw0 | e4aw0A2 | A:75-359 |
| O15530 | DB00171 | ATP | 4aw1 | e4aw1A2 | A:66-359 |
| O15530 | DB00171 | ATP | 4ct1 | e4ct1A1 | A:76-359 |
| O15530 | DB00171 | ATP | 4ct2 | e4ct2A1 | A:75-359 |
| O15530 | DB00171 | ATP | 4rqk | e4rqkA1 | A:74-359 |
| O15530 | DB00171 | ATP | 4rqv | e4rqvA1 | A:71-359 |
| O15530 | DB00171 | ATP | 4rrv | e4rrvA1 | A:76-359 |
| O15530 | DB00171 | ATP | 4xx9 | e4xx9A1 | A:71-359 |
| O15530 | DB00171 | ATP | 5ack | e5ackA1 | A:73-359 |
| O15530 | DB00171 | ATP | 5lvo | e5lvoA1 | A:73-359 |
| O15530 | DB00171 | ATP | 5lvp | e5lvpA1 | A:75-359 |
| O15530 | DB00171 | ATP | 5lvp | e5lvpB1 | B:74-359 |
| O15530 | DB00171 | ATP | 5lvp | e5lvpC1 | C:75-359 |
| O15530 | DB00171 | ATP | 5lvp | e5lvpD1 | D:74-359 |
| O15530 | DB00171 | ATP | 5mrd | e5mrdA1 | A:76-359 |