Attributes
UniProt ID
Protein Name
Orotidine 5'-phosphate decarboxylase
Ligand Name
5,6-dihydroorotidine 5'-monophosphate
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZVESSEXVBFSYOC-NFTAXOAUSA-N
SMILES
C1C(N(C(=O)NC1=O)C2C(C(C(O2)COP(=O)(O)O)O)O)C(=O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3G1F
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3g1fA1e3g1fB1e3g1fC1e3g1fD1e3g1fE1e3g1fF1e3g1fG1e3g1fH1e3g1fI1e3g1fJ1e3g1fK1e3g1fL1e3g1fM1
ECOD domains from experimental PDB structures interacting with ligand 2OM
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| O26232 | n/a | 2OM | 3g1f | e3g1fA1 | A:6-225 |
| O26232 | n/a | 2OM | 3g1f | e3g1fB1 | B:10-225 |
| O26232 | n/a | 2OM | 3g1f | e3g1fC1 | C:8-225 |
| O26232 | n/a | 2OM | 3g1f | e3g1fD1 | D:11-225 |
| O26232 | n/a | 2OM | 3g1f | e3g1fE1 | E:9-225 |
| O26232 | n/a | 2OM | 3g1f | e3g1fF1 | F:9-225 |
| O26232 | n/a | 2OM | 3g1f | e3g1fG1 | G:9-225 |
| O26232 | n/a | 2OM | 3g1f | e3g1fH1 | H:10-225 |
| O26232 | n/a | 2OM | 3g1f | e3g1fI1 | I:14-225 |
| O26232 | n/a | 2OM | 3g1f | e3g1fJ1 | J:8-225 |
| O26232 | n/a | 2OM | 3g1f | e3g1fK1 | K:10-225 |
| O26232 | n/a | 2OM | 3g1f | e3g1fL1 | L:10-225 |
| O26232 | n/a | 2OM | 3g1f | e3g1fM1 | M:9-225 |