Attributes
UniProt ID
Protein Name
Orotidine 5'-phosphate decarboxylase
Ligand Name
1-(5'-PHOSPHO-BETA-D-RIBOFURANOSYL)BARBITURIC ACID
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
AODYJUNLDJOADV-YXZULKJRSA-N
SMILES
C1C(=O)NC(=O)N(C1=O)C2C(C(C(O2)COP(=O)(O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3LHT
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3lhtA1e3lhtB1
ECOD domains from experimental PDB structures interacting with ligand DB03668
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| O26232 | DB03668 | BMQ | 3lht | e3lhtA1 | A:8-225 |
| O26232 | DB03668 | BMQ | 3lht | e3lhtB1 | B:9-225 |
| O26232 | DB03668 | BMQ | 3lhu | e3lhuA1 | A:8-225 |
| O26232 | DB03668 | BMQ | 3lhu | e3lhuB1 | B:9-225 |
| O26232 | DB03668 | BMQ | 3lhv | e3lhvA1 | A:8-225 |
| O26232 | DB03668 | BMQ | 3lhv | e3lhvB1 | B:9-225 |
| O26232 | DB03668 | BMQ | 3lhv | e3lhvC1 | C:8-225 |
| O26232 | DB03668 | BMQ | 3lhv | e3lhvD1 | D:9-225 |
| O26232 | DB03668 | BMQ | 3lhw | e3lhwA1 | A:8-225 |
| O26232 | DB03668 | BMQ | 3lhw | e3lhwB1 | B:9-225 |
| O26232 | DB03668 | BMQ | 3lhy | e3lhyA1 | A:8-225 |
| O26232 | DB03668 | BMQ | 3lhy | e3lhyB1 | B:9-225 |
| O26232 | DB03668 | BMQ | 3lhz | e3lhzA1 | A:8-225 |
| O26232 | DB03668 | BMQ | 3lhz | e3lhzB1 | B:9-225 |
| O26232 | DB03668 | BMQ | 3li0 | e3li0A1 | A:3-228 |
| O26232 | DB03668 | BMQ | 3li0 | e3li0B1 | B:3-226 |
| O26232 | DB03668 | BMQ | 3li1 | e3li1A1 | A:8-225 |
| O26232 | DB03668 | BMQ | 3li1 | e3li1B1 | B:9-225 |