Attributes
UniProt ID
Protein Name
Orotidine 5'-phosphate decarboxylase
Ligand Name
5,6-DIHYDROURIDINE-5'-MONOPHOSPHATE
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
NBWDKGJHOHJBRJ-XVFCMESISA-N
SMILES
C1CN(C(=O)NC1=O)C2C(C(C(O2)COP(=O)(O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3G1H
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3g1hA1e3g1hB1e3g1hC1e3g1hD1e3g1hE1e3g1hF1e3g1hG1e3g1hH1e3g1hI1e3g1hJ1e3g1hK1e3g1hL1e3g1hM1
ECOD domains from experimental PDB structures interacting with ligand H2U
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| O26232 | n/a | H2U | 3g1h | e3g1hA1 | A:5-225 |
| O26232 | n/a | H2U | 3g1h | e3g1hB1 | B:10-225 |
| O26232 | n/a | H2U | 3g1h | e3g1hC1 | C:8-225 |
| O26232 | n/a | H2U | 3g1h | e3g1hD1 | D:11-225 |
| O26232 | n/a | H2U | 3g1h | e3g1hE1 | E:9-225 |
| O26232 | n/a | H2U | 3g1h | e3g1hF1 | F:9-225 |
| O26232 | n/a | H2U | 3g1h | e3g1hG1 | G:9-225 |
| O26232 | n/a | H2U | 3g1h | e3g1hH1 | H:10-225 |
| O26232 | n/a | H2U | 3g1h | e3g1hI1 | I:14-225 |
| O26232 | n/a | H2U | 3g1h | e3g1hJ1 | J:8-225 |
| O26232 | n/a | H2U | 3g1h | e3g1hK1 | K:10-225 |
| O26232 | n/a | H2U | 3g1h | e3g1hL1 | L:10-225 |
| O26232 | n/a | H2U | 3g1h | e3g1hM1 | M:9-225 |
| O26232 | n/a | H2U | 4o8r | e4o8rA1 | A:5-224 |
| O26232 | n/a | H2U | 4o8r | e4o8rB1 | B:7-225 |
| O26232 | n/a | H2U | 4o8r | e4o8rC1 | C:1-225 |
| O26232 | n/a | H2U | 4o8r | e4o8rD1 | D:8-223 |
| O26232 | n/a | H2U | 4o8r | e4o8rE1 | E:9-225 |
| O26232 | n/a | H2U | 4o8r | e4o8rF1 | F:9-223 |
| O26232 | n/a | H2U | 4o8r | e4o8rG1 | G:9-221 |
| O26232 | n/a | H2U | 4o8r | e4o8rH1 | H:8-222 |
| O26232 | n/a | H2U | 4o8r | e4o8rI1 | I:15-221 |
| O26232 | n/a | H2U | 4o8r | e4o8rJ1 | J:8-225 |
| O26232 | n/a | H2U | 4o8r | e4o8rK1 | K:10-225 |
| O26232 | n/a | H2U | 4o8r | e4o8rL1 | L:10-222 |
| O26232 | n/a | H2U | 4o8r | e4o8rM1 | M:8-225 |