Attributes
UniProt ID
Protein Name
Orotidine 5'-phosphate decarboxylase
Ligand Name
URIDINE-5'-MONOPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
DJJCXFVJDGTHFX-XVFCMESISA-N
SMILES
C1=CN(C(=O)NC1=O)C2C(C(C(O2)COP(=O)(O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1KLZ
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1klzA1
ECOD domains from experimental PDB structures interacting with ligand DB03685
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| O26232 | DB03685 | U5P | 1klz | e1klzA1 | A:14-222 |
| O26232 | DB03685 | U5P | 1km4 | e1km4A1 | A:11-222 |
| O26232 | DB03685 | U5P | 1loq | e1loqA1 | A:14-222 |
| O26232 | DB03685 | U5P | 2e6y | e2e6yA1 | A:11-222 |
| O26232 | DB03685 | U5P | 2e6y | e2e6yB1 | B:1011-1222 |
| O26232 | DB03685 | U5P | 3g1d | e3g1dA1 | A:8-225 |
| O26232 | DB03685 | U5P | 3g1d | e3g1dB1 | B:9-225 |
| O26232 | DB03685 | U5P | 3g1x | e3g1xA1 | A:11-223 |
| O26232 | DB03685 | U5P | 3g1x | e3g1xB1 | B:11-223 |
| O26232 | DB03685 | U5P | 3g22 | e3g22A1 | A:8-225 |
| O26232 | DB03685 | U5P | 3g22 | e3g22B1 | B:9-225 |
| O26232 | DB03685 | U5P | 3w07 | e3w07A1 | A:11-225 |
| O26232 | DB03685 | U5P | 4nuw | e4nuwA1 | A:8-226 |
| O26232 | DB03685 | U5P | 4nuw | e4nuwB1 | B:8-226 |