Attributes
UniProt ID
Protein Name
CCA-adding enzyme
Ligand Name
ADENOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZKHQWZAMYRWXGA-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1R8B
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1r8bA1e1r8bA2e1r8bA3
ECOD domains from experimental PDB structures interacting with ligand DB00171
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| O28126 | DB00171 | ATP | 1r8b | e1r8bA2 | A:258-437 |
| O28126 | DB00171 | ATP | 1tfw | e1tfwB1 | B:143-257 |
| O28126 | DB00171 | ATP | 1tfw | e1tfwB3 | B:1-142 |
| O28126 | DB00171 | ATP | 1tfw | e1tfwD1 | D:143-257 |
| O28126 | DB00171 | ATP | 1tfw | e1tfwD3 | D:1-142 |
| O28126 | DB00171 | ATP | 1uev | e1uevA1 | A:143-257 |
| O28126 | DB00171 | ATP | 1uev | e1uevA3 | A:2-142 |
| O28126 | DB00171 | ATP | 2dra | e2draA1 | A:143-257 |
| O28126 | DB00171 | ATP | 2dra | e2draA3 | A:1-142 |
| O28126 | DB00171 | ATP | 2zh6 | e2zh6A1 | A:143-257 |
| O28126 | DB00171 | ATP | 2zh6 | e2zh6A3 | A:1-142 |
| O28126 | DB00171 | ATP | 3ov7 | e3ov7A1 | A:143-257 |
| O28126 | DB00171 | ATP | 3ov7 | e3ov7A3 | A:1-142 |
| O28126 | DB00171 | ATP | 3ov7 | e3ov7B1 | B:143-257 |
| O28126 | DB00171 | ATP | 3ov7 | e3ov7B3 | B:1-142 |
| O28126 | DB00171 | ATP | 3ovb | e3ovbA1 | A:143-257 |
| O28126 | DB00171 | ATP | 3ovb | e3ovbA2 | A:258-441 |
| O28126 | DB00171 | ATP | 3ovb | e3ovbA3 | A:1-142 |
| O28126 | DB00171 | ATP | 3ovb | e3ovbB1 | B:143-257 |
| O28126 | DB00171 | ATP | 3ovb | e3ovbB3 | B:1-142 |