Attributes
UniProt ID
Protein Name
Proteasome-activating nucleotidase
Ligand Name
ADENOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XTWYTFMLZFPYCI-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6HE4
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6he4H1e6he4H2e6he4I1e6he4I2e6he4J1e6he4J2e6he4K1e6he4K2e6he4L1e6he4L2e6he4M1e6he4M2
ECOD domains from experimental PDB structures interacting with ligand DB16833
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| O28303 | DB16833 | ADP | 6he4 | e6he4L1 | L:123-306 |
| O28303 | DB16833 | ADP | 6he4 | e6he4L2 | L:307-389 |
| O28303 | DB16833 | ADP | 6he4 | e6he4M1 | M:123-306 |
| O28303 | DB16833 | ADP | 6he8 | e6he8H1 | H:123-310 |
| O28303 | DB16833 | ADP | 6he8 | e6he8M1 | M:123-310 |
| O28303 | DB16833 | ADP | 6he8 | e6he8M2 | M:311-398 |
| O28303 | DB16833 | ADP | 6he9 | e6he9L1 | L:311-398 |
| O28303 | DB16833 | ADP | 6he9 | e6he9L2 | L:123-310 |
| O28303 | DB16833 | ADP | 6he9 | e6he9M1 | M:123-310 |
| O28303 | DB16833 | ADP | 6hea | e6heaK1 | K:311-398 |
| O28303 | DB16833 | ADP | 6hea | e6heaK3 | K:123-310 |
| O28303 | DB16833 | ADP | 6hea | e6heaL3 | L:123-310 |
| O28303 | DB16833 | ADP | 6hec | e6hecJ1 | J:123-310 |
| O28303 | DB16833 | ADP | 6hec | e6hecJ3 | J:311-398 |
| O28303 | DB16833 | ADP | 6hec | e6hecK3 | K:123-310 |
| O28303 | DB16833 | ADP | 6hed | e6hedI2 | I:123-310 |
| O28303 | DB16833 | ADP | 6hed | e6hedI3 | I:311-398 |
| O28303 | DB16833 | ADP | 6hed | e6hedJ2 | J:123-310 |