Attributes
UniProt ID
Protein Name
Myo-inositol-1-phosphate synthase
Ligand Name
NICOTINAMIDE-ADENINE-DINUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
BAWFJGJZGIEFAR-NNYOXOHSSA-N
SMILES
c1cc(c[n+](c1)C2C(C(C(O2)COP(=O)([O-])OP(=O)(O)OCC3C(C(C(O3)n4cnc5c4ncnc5N)O)O)O)O)C(=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1U1I
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1u1iA1e1u1iA2e1u1iB1e1u1iB2e1u1iC1e1u1iC2e1u1iD1e1u1iD2
ECOD domains from experimental PDB structures interacting with ligand DB14128
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| O28480 | DB14128 | NAD | 1u1i | e1u1iA1 | A:228-332 |
| O28480 | DB14128 | NAD | 1u1i | e1u1iA2 | A:1-227,A:333-392 |
| O28480 | DB14128 | NAD | 1u1i | e1u1iB1 | B:628-732 |
| O28480 | DB14128 | NAD | 1u1i | e1u1iB2 | B:401-627,B:733-792 |
| O28480 | DB14128 | NAD | 1u1i | e1u1iC1 | C:1028-1132 |
| O28480 | DB14128 | NAD | 1u1i | e1u1iC2 | C:801-1027,C:1133-1192 |
| O28480 | DB14128 | NAD | 1u1i | e1u1iD1 | D:1428-1532 |
| O28480 | DB14128 | NAD | 1u1i | e1u1iD2 | D:1201-1427,D:1533-1592 |
| O28480 | DB14128 | NAD | 3qvs | e3qvsA1 | A:228-332 |
| O28480 | DB14128 | NAD | 3qvs | e3qvsA2 | A:1-227,A:333-392 |
| O28480 | DB14128 | NAD | 3qvw | e3qvwA1 | A:228-332 |
| O28480 | DB14128 | NAD | 3qvw | e3qvwA2 | A:1-227,A:333-392 |
| O28480 | DB14128 | NAD | 3qvx | e3qvxA1 | A:228-332 |
| O28480 | DB14128 | NAD | 3qvx | e3qvxA2 | A:1-227,A:333-392 |
| O28480 | DB14128 | NAD | 3qw2 | e3qw2A1 | A:228-332 |
| O28480 | DB14128 | NAD | 3qw2 | e3qw2A2 | A:1-227,A:333-392 |
| O28480 | DB14128 | NAD | 3qw2 | e3qw2B1 | B:228-332 |
| O28480 | DB14128 | NAD | 3qw2 | e3qw2B2 | B:1-227,B:333-392 |
| O28480 | DB14128 | NAD | 3qw2 | e3qw2C1 | C:228-332 |
| O28480 | DB14128 | NAD | 3qw2 | e3qw2C2 | C:1-227,C:333-392 |
| O28480 | DB14128 | NAD | 3qw2 | e3qw2D1 | D:228-332 |
| O28480 | DB14128 | NAD | 3qw2 | e3qw2D2 | D:1-227,D:333-392 |