Attributes
UniProt ID
Protein Name
Vitamin B12-dependent ribonucleotide reductase
Ligand Name
THYMIDINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
NHVNXKFIZYSCEB-XLPZGREQSA-N
SMILES
CC1=CN(C(=O)NC1=O)C2CC(C(O2)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1XJE
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1xjeA3e1xjeA4e1xjeB1e1xjeB3
ECOD domains from experimental PDB structures interacting with ligand DB02452
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| O33839 | DB02452 | TTP | 1xje | e1xjeA3 | A:101-633 |
| O33839 | DB02452 | TTP | 1xje | e1xjeB1 | B:130-633 |
| O33839 | DB02452 | TTP | 1xje | e1xjeB3 | B:1-132 |
| O33839 | DB02452 | TTP | 1xjm | e1xjmA1 | A:130-633 |
| O33839 | DB02452 | TTP | 1xjm | e1xjmA3 | A:1-132 |
| O33839 | DB02452 | TTP | 1xjm | e1xjmB1 | B:130-632 |
| O33839 | DB02452 | TTP | 1xjm | e1xjmB3 | B:1-132 |
| O33839 | DB02452 | TTP | 3o0n | e3o0nA3 | A:101-633 |
| O33839 | DB02452 | TTP | 3o0n | e3o0nB2 | B:1-132 |
| O33839 | DB02452 | TTP | 3o0n | e3o0nB3 | B:130-633 |
| O33839 | DB02452 | TTP | 3o0o | e3o0oA1 | A:130-633 |
| O33839 | DB02452 | TTP | 3o0o | e3o0oA3 | A:1-132 |
| O33839 | DB02452 | TTP | 3o0o | e3o0oB1 | B:130-633 |
| O33839 | DB02452 | TTP | 3o0o | e3o0oB3 | B:1-132 |
| O33839 | DB02452 | TTP | 3o0q | e3o0qA1 | A:130-633 |
| O33839 | DB02452 | TTP | 3o0q | e3o0qA3 | A:1-132 |
| O33839 | DB02452 | TTP | 3o0q | e3o0qB1 | B:130-633 |
| O33839 | DB02452 | TTP | 3o0q | e3o0qB3 | B:1-132 |