Attributes
UniProt ID
Protein Name
Probable flavin-dependent thymidylate synthase
Ligand Name
FLAVIN-ADENINE DINUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
VWWQXMAJTJZDQX-UYBVJOGSSA-N
SMILES
Cc1cc2c(cc1C)N(C3=NC(=O)NC(=O)C3=N2)CC(C(C(COP(=O)(O)OP(=O)(O)OCC4C(C(C(O4)n5cnc6c5ncnc6N)O)O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2CFA
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2cfaA1e2cfaB1
ECOD domains from experimental PDB structures interacting with ligand DB03147
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| O41156 | DB03147 | FAD | 2cfa | e2cfaA1 | A:1-89,A:124-217 |
| O41156 | DB03147 | FAD | 2cfa | e2cfaB1 | B:1-88,B:125-215 |
| O41156 | DB03147 | FAD | 4fzb | e4fzbA2 | A:0-94,A:120-215 |
| O41156 | DB03147 | FAD | 4fzb | e4fzbB2 | B:0-94,B:123-215 |
| O41156 | DB03147 | FAD | 4fzb | e4fzbC1 | C:-3-217 |
| O41156 | DB03147 | FAD | 4fzb | e4fzbD2 | D:0-216 |
| O41156 | DB03147 | FAD | 4fzb | e4fzbE1 | E:-4-201 |
| O41156 | DB03147 | FAD | 4fzb | e4fzbF1 | F:-4-201 |
| O41156 | DB03147 | FAD | 4fzb | e4fzbG2 | G:0-94,G:123-215 |
| O41156 | DB03147 | FAD | 4fzb | e4fzbH2 | H:1-94,H:123-215 |
| O41156 | DB03147 | FAD | 4fzb | e4fzbI3 | I:1-215 |
| O41156 | DB03147 | FAD | 4fzb | e4fzbJ2 | J:1-92,J:123-216 |
| O41156 | DB03147 | FAD | 4fzb | e4fzbK2 | K:1-215 |
| O41156 | DB03147 | FAD | 4fzb | e4fzbL2 | L:1-215 |
| O41156 | DB03147 | FAD | 4fzb | e4fzbM2 | M:0-216 |
| O41156 | DB03147 | FAD | 4fzb | e4fzbN2 | N:1-92,N:123-216 |
| O41156 | DB03147 | FAD | 4fzb | e4fzbO2 | O:1-215 |
| O41156 | DB03147 | FAD | 4fzb | e4fzbP3 | P:1-215 |