Attributes
UniProt ID
Protein Name
Orexin/Hypocretin receptor type 1
Ligand Name
octyl 1-thio-beta-D-glucopyranoside
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
CGVLVOOFCGWBCS-RGDJUOJXSA-N
SMILES
CCCCCCCCSC1C(C(C(C(O1)CO)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6TO7
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6to7A1e6to7B1
ECOD domains from experimental PDB structures interacting with ligand DB08558
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| O43613 | DB08558 | SOG | 6to7 | e6to7A1 | A:45-377 |
| O43613 | DB08558 | SOG | 6to7 | e6to7B1 | B:30-383 |
| O43613 | DB08558 | SOG | 6tod | e6todA1 | A:45-378 |
| O43613 | DB08558 | SOG | 6tod | e6todB1 | B:29-383 |
| O43613 | DB08558 | SOG | 6tos | e6tosA1 | A:27-377 |
| O43613 | DB08558 | SOG | 6tos | e6tosB1 | B:39-377 |
| O43613 | DB08558 | SOG | 6tot | e6totA1 | A:27-376 |
| O43613 | DB08558 | SOG | 6tot | e6totB1 | B:43-377 |
| O43613 | DB08558 | SOG | 6tp3 | e6tp3A1 | A:32-251,A:253-377 |
| O43613 | DB08558 | SOG | 6tp3 | e6tp3B1 | B:27-251,B:253-378 |
| O43613 | DB08558 | SOG | 6tp4 | e6tp4A1 | A:28-375 |
| O43613 | DB08558 | SOG | 6tp4 | e6tp4B1 | B:46-377 |
| O43613 | DB08558 | SOG | 6tp6 | e6tp6A1 | A:25-252,A:285-376 |
| O43613 | DB08558 | SOG | 6tp6 | e6tp6B1 | B:43-252,B:285-377 |
| O43613 | DB08558 | SOG | 6tq4 | e6tq4A1 | A:26-243,A:287-375 |
| O43613 | DB08558 | SOG | 6tq4 | e6tq4B1 | B:45-252,B:285-378 |
| O43613 | DB08558 | SOG | 6tq6 | e6tq6A1 | A:28-244,A:289-375 |
| O43613 | DB08558 | SOG | 6tq6 | e6tq6B1 | B:45-252,B:285-377 |
| O43613 | DB08558 | SOG | 6tq7 | e6tq7A1 | A:45-252,A:285-377 |
| O43613 | DB08558 | SOG | 6tq7 | e6tq7B1 | B:25-252,B:285-378 |
| O43613 | DB08558 | SOG | 6tq9 | e6tq9A1 | A:27-376 |
| O43613 | DB08558 | SOG | 6tq9 | e6tq9B1 | B:45-378 |