Attributes
UniProt ID
Protein Name
Origin recognition complex subunit 4
Ligand Name
ADENOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZKHQWZAMYRWXGA-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5UJ7
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5uj7A1e5uj7A2e5uj7A3e5uj7B1e5uj7B2e5uj7B3e5uj7C1e5uj7C2e5uj7C3e5uj7D1e5uj7D2e5uj7D3e5uj7E1e5uj7F1
ECOD domains from experimental PDB structures interacting with ligand DB00171
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| O43929 | DB00171 | ATP | 5uj7 | e5uj7C2 | C:17-221 |
| O43929 | DB00171 | ATP | 5uj7 | e5uj7C3 | C:222-311 |
| O43929 | DB00171 | ATP | 5uj7 | e5uj7D1 | D:17-221 |
| O43929 | DB00171 | ATP | 5uj7 | e5uj7D3 | D:222-311 |
| O43929 | DB00171 | ATP | 5ujm | e5ujmD1 | D:17-221 |
| O43929 | DB00171 | ATP | 5ujm | e5ujmD2 | D:222-311 |
| O43929 | DB00171 | ATP | 7cte | e7cteD1 | D:14-221 |
| O43929 | DB00171 | ATP | 7cte | e7cteD3 | D:222-311 |
| O43929 | DB00171 | ATP | 7ctf | e7ctfD1 | D:14-221 |
| O43929 | DB00171 | ATP | 7ctf | e7ctfD3 | D:222-311 |
| O43929 | DB00171 | ATP | 7ctg | e7ctgD2 | D:222-311 |
| O43929 | DB00171 | ATP | 7ctg | e7ctgD3 | D:14-221 |
| O43929 | DB00171 | ATP | 7jpo | e7jpoD1 | D:17-221 |
| O43929 | DB00171 | ATP | 7jpo | e7jpoD3 | D:222-311 |
| O43929 | DB00171 | ATP | 7jpp | e7jppD2 | D:222-311 |
| O43929 | DB00171 | ATP | 7jpp | e7jppD3 | D:17-221 |
| O43929 | DB00171 | ATP | 7jpq | e7jpqD2 | D:17-221 |
| O43929 | DB00171 | ATP | 7jpq | e7jpqD3 | D:222-311 |
| O43929 | DB00171 | ATP | 7jpr | e7jprD1 | D:17-221 |
| O43929 | DB00171 | ATP | 7jpr | e7jprD3 | D:222-311 |
| O43929 | DB00171 | ATP | 7jps | e7jpsD1 | D:222-311 |
| O43929 | DB00171 | ATP | 7jps | e7jpsD2 | D:17-221 |