Attributes
UniProt ID
Protein Name
235aa long hypothetical biotin-- ligase
Ligand Name
BIOTIN
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
YBJHBAHKTGYVGT-ZKWXMUAHSA-N
SMILES
C1C2C(C(S1)CCCCC(=O)O)NC(=O)N2
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1WPY
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1wpyA1e1wpyA2e1wpyB1e1wpyB2
ECOD domains from experimental PDB structures interacting with ligand DB00121
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| O57883 | DB00121 | BTN | 1wpy | e1wpyA2 | A:1-188 |
| O57883 | DB00121 | BTN | 1wpy | e1wpyB2 | B:1-188 |
| O57883 | DB00121 | BTN | 2dth | e2dthA2 | A:1-188 |
| O57883 | DB00121 | BTN | 2dth | e2dthB2 | B:1-188 |
| O57883 | DB00121 | BTN | 2dto | e2dtoA2 | A:1-188 |
| O57883 | DB00121 | BTN | 2dto | e2dtoB2 | B:1-188 |
| O57883 | DB00121 | BTN | 2dxt | e2dxtA2 | A:1-188 |
| O57883 | DB00121 | BTN | 2dxt | e2dxtB2 | B:1-188 |
| O57883 | DB00121 | BTN | 2ejf | e2ejfA1 | A:189-235 |
| O57883 | DB00121 | BTN | 2ejf | e2ejfA2 | A:1-188 |
| O57883 | DB00121 | BTN | 2ejf | e2ejfB2 | B:1-188 |
| O57883 | DB00121 | BTN | 2ejg | e2ejgA2 | A:1-188 |
| O57883 | DB00121 | BTN | 2ejg | e2ejgB2 | B:1-188 |
| O57883 | DB00121 | BTN | 2fyk | e2fykA2 | A:1-188 |
| O57883 | DB00121 | BTN | 2fyk | e2fykB2 | B:1-188 |
| O57883 | DB00121 | BTN | 2zgw | e2zgwA2 | A:1-188 |
| O57883 | DB00121 | BTN | 2zgw | e2zgwB2 | B:1-188 |