Attributes
UniProt ID
Protein Name
Ribose 1,5-bisphosphate isomerase
Ligand Name
GUANOSINE-5'-MONOPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
RQFCJASXJCIDSX-UUOKFMHZSA-N
SMILES
c1nc2c(n1C3C(C(C(O3)COP(=O)(O)O)O)O)N=C(NC2=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5YG5
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5yg5A1e5yg5A2e5yg5B1e5yg5B2e5yg5C1e5yg5C2
ECOD domains from experimental PDB structures interacting with ligand DB01972
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| O57947 | DB01972 | 5GP | 5yg5 | e5yg5A2 | A:113-324 |
| O57947 | DB01972 | 5GP | 5yg5 | e5yg5B2 | B:113-324 |
| O57947 | DB01972 | 5GP | 5yg5 | e5yg5C2 | C:113-324 |
| O57947 | DB01972 | 5GP | 5yg6 | e5yg6A2 | A:113-324 |
| O57947 | DB01972 | 5GP | 5yg6 | e5yg6B1 | B:113-324 |
| O57947 | DB01972 | 5GP | 5yg6 | e5yg6C1 | C:113-324 |
| O57947 | DB01972 | 5GP | 5yg7 | e5yg7A1 | A:113-324 |
| O57947 | DB01972 | 5GP | 5yg7 | e5yg7B1 | B:113-324 |
| O57947 | DB01972 | 5GP | 5yg7 | e5yg7C2 | C:113-324 |
| O57947 | DB01972 | 5GP | 5yg8 | e5yg8B1 | B:113-324 |
| O57947 | DB01972 | 5GP | 5yg8 | e5yg8C1 | C:113-324 |
| O57947 | DB01972 | 5GP | 5yg9 | e5yg9B1 | B:113-324 |
| O57947 | DB01972 | 5GP | 5yg9 | e5yg9C1 | C:113-324 |
| O57947 | DB01972 | 5GP | 5yga | e5ygaB2 | B:113-324 |
| O57947 | DB01972 | 5GP | 5yga | e5ygaC2 | C:113-324 |