Attributes
UniProt ID
Protein Name
Ribose 1,5-bisphosphate isomerase
Ligand Name
ADENOSINE MONOPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
UDMBCSSLTHHNCD-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5YFU
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5yfuA1e5yfuA2e5yfuB1e5yfuB2e5yfuC1e5yfuC2
ECOD domains from experimental PDB structures interacting with ligand DB00131
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| O57947 | DB00131 | AMP | 5yfu | e5yfuA1 | A:113-324 |
| O57947 | DB00131 | AMP | 5yfu | e5yfuB2 | B:113-324 |
| O57947 | DB00131 | AMP | 5yfu | e5yfuC1 | C:113-324 |
| O57947 | DB00131 | AMP | 5yfv | e5yfvA1 | A:113-324 |
| O57947 | DB00131 | AMP | 5yfv | e5yfvB2 | B:113-324 |
| O57947 | DB00131 | AMP | 5yfv | e5yfvC2 | C:113-324 |
| O57947 | DB00131 | AMP | 5yfw | e5yfwA2 | A:113-324 |
| O57947 | DB00131 | AMP | 5yfw | e5yfwB1 | B:113-324 |
| O57947 | DB00131 | AMP | 5yfw | e5yfwC2 | C:113-324 |
| O57947 | DB00131 | AMP | 5yfx | e5yfxA2 | A:113-323 |
| O57947 | DB00131 | AMP | 5yg8 | e5yg8A1 | A:113-324 |
| O57947 | DB00131 | AMP | 5yg8 | e5yg8B1 | B:113-324 |
| O57947 | DB00131 | AMP | 5yg8 | e5yg8C1 | C:113-324 |
| O57947 | DB00131 | AMP | 5yg9 | e5yg9A2 | A:113-324 |
| O57947 | DB00131 | AMP | 5yg9 | e5yg9B1 | B:113-324 |
| O57947 | DB00131 | AMP | 5yg9 | e5yg9C1 | C:113-324 |
| O57947 | DB00131 | AMP | 5yga | e5ygaA2 | A:113-324 |
| O57947 | DB00131 | AMP | 5yga | e5ygaB2 | B:113-324 |
| O57947 | DB00131 | AMP | 5yga | e5ygaC2 | C:113-324 |