Attributes
UniProt ID
Protein Name
Aldo-keto reductase family 1 member B10
Ligand Name
NADP NICOTINAMIDE-ADENINE-DINUCLEOTIDE PHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XJLXINKUBYWONI-NNYOXOHSSA-N
SMILES
c1cc(c[n+](c1)C2C(C(C(O2)COP(=O)([O-])OP(=O)(O)OCC3C(C(C(O3)n4cnc5c4ncnc5N)OP(=O)(O)O)O)O)O)C(=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4GA8
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4ga8A1
ECOD domains from experimental PDB structures interacting with ligand DB03461
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| O60218 | DB03461 | NAP | 4ga8 | e4ga8A1 | A:1-316 |
| O60218 | DB03461 | NAP | 4gab | e4gabA1 | A:1-316 |
| O60218 | DB03461 | NAP | 4gq0 | e4gq0A1 | A:-1-316 |
| O60218 | DB03461 | NAP | 4gqg | e4gqgA1 | A:-1-316 |
| O60218 | DB03461 | NAP | 4i5x | e4i5xA1 | A:-1-316 |
| O60218 | DB03461 | NAP | 4icc | e4iccX1 | X:1-316 |
| O60218 | DB03461 | NAP | 4jih | e4jihA1 | A:-1-316 |
| O60218 | DB03461 | NAP | 4jii | e4jiiX1 | X:-1-316 |
| O60218 | DB03461 | NAP | 4wev | e4wevX1 | X:1-316 |
| O60218 | DB03461 | NAP | 4xzl | e4xzlX1 | X:1-316 |
| O60218 | DB03461 | NAP | 4xzm | e4xzmX1 | X:1-316 |
| O60218 | DB03461 | NAP | 4xzn | e4xznX1 | X:1-316 |
| O60218 | DB03461 | NAP | 5lik | e5likX1 | X:1-316 |
| O60218 | DB03461 | NAP | 5liu | e5liuX1 | X:1-316 |
| O60218 | DB03461 | NAP | 5liw | e5liwX1 | X:1-316 |
| O60218 | DB03461 | NAP | 5lix | e5lixX1 | X:1-316 |
| O60218 | DB03461 | NAP | 5liy | e5liyX1 | X:1-316 |
| O60218 | DB03461 | NAP | 5m2f | e5m2fX1 | X:1-316 |
| O60218 | DB03461 | NAP | 5y7n | e5y7nA1 | A:4-316 |