Attributes
UniProt ID
Protein Name
Acyl-coenzyme A oxidase acox-1.1
Ligand Name
ADENOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZKHQWZAMYRWXGA-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5K3I
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5k3iA1e5k3iA2e5k3iA3e5k3iA4e5k3iB1e5k3iB2e5k3iB3e5k3iB4e5k3iC1e5k3iC2e5k3iC3e5k3iC4e5k3iD1e5k3iD2e5k3iD3e5k3iD4e5k3iE1e5k3iE2e5k3iE3e5k3iE4e5k3iF1e5k3iF2e5k3iF3e5k3iF4e5k3iG1e5k3iG2e5k3iG3e5k3iG4e5k3iH1e5k3iH2e5k3iH3e5k3iH4
ECOD domains from experimental PDB structures interacting with ligand DB00171
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| O62140 | DB00171 | ATP | 5k3i | e5k3iA1 | A:473-669 |
| O62140 | DB00171 | ATP | 5k3i | e5k3iA2 | A:283-472 |
| O62140 | DB00171 | ATP | 5k3i | e5k3iB1 | B:283-472 |
| O62140 | DB00171 | ATP | 5k3i | e5k3iB4 | B:473-669 |
| O62140 | DB00171 | ATP | 5k3i | e5k3iC3 | C:473-669 |
| O62140 | DB00171 | ATP | 5k3i | e5k3iC4 | C:283-472 |
| O62140 | DB00171 | ATP | 5k3i | e5k3iD2 | D:474-669 |
| O62140 | DB00171 | ATP | 5k3i | e5k3iD4 | D:283-473 |
| O62140 | DB00171 | ATP | 5k3i | e5k3iE2 | E:283-473 |
| O62140 | DB00171 | ATP | 5k3i | e5k3iE3 | E:474-669 |
| O62140 | DB00171 | ATP | 5k3i | e5k3iF2 | F:290-472 |
| O62140 | DB00171 | ATP | 5k3i | e5k3iF3 | F:473-669 |
| O62140 | DB00171 | ATP | 5k3i | e5k3iG2 | G:282-472 |
| O62140 | DB00171 | ATP | 5k3i | e5k3iG4 | G:473-669 |
| O62140 | DB00171 | ATP | 5k3i | e5k3iH1 | H:283-472 |
| O62140 | DB00171 | ATP | 5k3i | e5k3iH3 | H:473-669 |