Attributes
UniProt ID
Protein Name
Acyl-coenzyme A oxidase acox-1.1
Ligand Name
FLAVIN-ADENINE DINUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
VWWQXMAJTJZDQX-UYBVJOGSSA-N
SMILES
Cc1cc2c(cc1C)N(C3=NC(=O)NC(=O)C3=N2)CC(C(C(COP(=O)(O)OP(=O)(O)OCC4C(C(C(O4)n5cnc6c5ncnc6N)O)O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5K3I
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5k3iA1e5k3iA2e5k3iA3e5k3iA4e5k3iB1e5k3iB2e5k3iB3e5k3iB4e5k3iC1e5k3iC2e5k3iC3e5k3iC4e5k3iD1e5k3iD2e5k3iD3e5k3iD4e5k3iE1e5k3iE2e5k3iE3e5k3iE4e5k3iF1e5k3iF2e5k3iF3e5k3iF4e5k3iG1e5k3iG2e5k3iG3e5k3iG4e5k3iH1e5k3iH2e5k3iH3e5k3iH4
ECOD domains from experimental PDB structures interacting with ligand DB03147
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| O62140 | DB03147 | FAD | 5k3i | e5k3iA2 | A:283-472 |
| O62140 | DB03147 | FAD | 5k3i | e5k3iA3 | A:2-143 |
| O62140 | DB03147 | FAD | 5k3i | e5k3iA4 | A:144-282 |
| O62140 | DB03147 | FAD | 5k3i | e5k3iB1 | B:283-472 |
| O62140 | DB03147 | FAD | 5k3i | e5k3iB2 | B:144-282 |
| O62140 | DB03147 | FAD | 5k3i | e5k3iB3 | B:2-143 |
| O62140 | DB03147 | FAD | 5k3i | e5k3iC1 | C:2-143 |
| O62140 | DB03147 | FAD | 5k3i | e5k3iC2 | C:144-282 |
| O62140 | DB03147 | FAD | 5k3i | e5k3iC4 | C:283-472 |
| O62140 | DB03147 | FAD | 5k3i | e5k3iD1 | D:144-282 |
| O62140 | DB03147 | FAD | 5k3i | e5k3iD3 | D:2-143 |
| O62140 | DB03147 | FAD | 5k3i | e5k3iD4 | D:283-473 |
| O62140 | DB03147 | FAD | 5k3i | e5k3iE1 | E:2-143 |
| O62140 | DB03147 | FAD | 5k3i | e5k3iE2 | E:283-473 |
| O62140 | DB03147 | FAD | 5k3i | e5k3iE4 | E:144-282 |
| O62140 | DB03147 | FAD | 5k3i | e5k3iF1 | F:2-143 |
| O62140 | DB03147 | FAD | 5k3i | e5k3iF2 | F:290-472 |
| O62140 | DB03147 | FAD | 5k3i | e5k3iF4 | F:144-280 |
| O62140 | DB03147 | FAD | 5k3i | e5k3iG1 | G:2-143 |
| O62140 | DB03147 | FAD | 5k3i | e5k3iG2 | G:282-472 |
| O62140 | DB03147 | FAD | 5k3i | e5k3iG3 | G:144-281 |
| O62140 | DB03147 | FAD | 5k3i | e5k3iH1 | H:283-472 |
| O62140 | DB03147 | FAD | 5k3i | e5k3iH2 | H:2-143 |
| O62140 | DB03147 | FAD | 5k3i | e5k3iH4 | H:144-282 |