Attributes
UniProt ID
Protein Name
Transcriptional regulator
Ligand Name
ADENOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZKHQWZAMYRWXGA-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3M0E
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3m0eA1e3m0eA2e3m0eB1e3m0eB2e3m0eC1e3m0eC2e3m0eD1e3m0eD2e3m0eE1e3m0eE2e3m0eF1e3m0eF2e3m0eG1e3m0eG2
ECOD domains from experimental PDB structures interacting with ligand DB00171
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| O67198 | DB00171 | ATP | 3m0e | e3m0eA1 | A:308-384 |
| O67198 | DB00171 | ATP | 3m0e | e3m0eA2 | A:138-307 |
| O67198 | DB00171 | ATP | 3m0e | e3m0eB1 | B:308-384 |
| O67198 | DB00171 | ATP | 3m0e | e3m0eB2 | B:138-307 |
| O67198 | DB00171 | ATP | 3m0e | e3m0eC1 | C:308-384 |
| O67198 | DB00171 | ATP | 3m0e | e3m0eC2 | C:138-307 |
| O67198 | DB00171 | ATP | 3m0e | e3m0eD1 | D:308-384 |
| O67198 | DB00171 | ATP | 3m0e | e3m0eD2 | D:138-307 |
| O67198 | DB00171 | ATP | 3m0e | e3m0eE1 | E:308-384 |
| O67198 | DB00171 | ATP | 3m0e | e3m0eE2 | E:138-307 |
| O67198 | DB00171 | ATP | 3m0e | e3m0eF1 | F:308-384 |
| O67198 | DB00171 | ATP | 3m0e | e3m0eF2 | F:138-307 |
| O67198 | DB00171 | ATP | 3m0e | e3m0eG1 | G:308-384 |
| O67198 | DB00171 | ATP | 3m0e | e3m0eG2 | G:138-307 |