Attributes
UniProt ID
Protein Name
Astrotactin-2
Ligand Name
D-MYO-INOSITOL-1,4,5-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
MMWCIQZXVOZEGG-XJTPDSDZSA-N
SMILES
C1(C(C(C(C(C1OP(=O)(O)O)O)OP(=O)(O)O)OP(=O)(O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5J67
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5j67A1e5j67A2e5j67A3e5j67A4e5j67A5e5j67B1e5j67B2e5j67B3e5j67B4e5j67B5e5j67C1e5j67C2e5j67C3e5j67C4e5j67C5e5j67D1e5j67D2e5j67D3e5j67D4e5j67D5
ECOD domains from experimental PDB structures interacting with ligand DB03401
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| O75129 | DB03401 | I3P | 5j67 | e5j67A1 | A:985-1012 |
| O75129 | DB03401 | I3P | 5j67 | e5j67A2 | A:1234-1288 |
| O75129 | DB03401 | I3P | 5j67 | e5j67A3 | A:1013-1138 |
| O75129 | DB03401 | I3P | 5j67 | e5j67A4 | A:717-984 |
| O75129 | DB03401 | I3P | 5j67 | e5j67B1 | B:1013-1138 |
| O75129 | DB03401 | I3P | 5j67 | e5j67B2 | B:985-1012 |
| O75129 | DB03401 | I3P | 5j67 | e5j67B5 | B:1234-1287 |
| O75129 | DB03401 | I3P | 5j67 | e5j67C2 | C:985-1012 |
| O75129 | DB03401 | I3P | 5j67 | e5j67C3 | C:1013-1138 |
| O75129 | DB03401 | I3P | 5j67 | e5j67C5 | C:1234-1288 |
| O75129 | DB03401 | I3P | 5j67 | e5j67D1 | D:1013-1138 |
| O75129 | DB03401 | I3P | 5j67 | e5j67D2 | D:1234-1285 |
| O75129 | DB03401 | I3P | 5j67 | e5j67D4 | D:985-1012 |
| O75129 | DB03401 | I3P | 5j67 | e5j67D5 | D:717-984 |
| O75129 | DB03401 | I3P | 5j68 | e5j68A2 | A:1234-1288 |
| O75129 | DB03401 | I3P | 5j68 | e5j68A3 | A:1013-1138 |
| O75129 | DB03401 | I3P | 5j68 | e5j68A4 | A:985-1012 |