Attributes
UniProt ID
Protein Name
Leucine-rich repeat-containing G-protein coupled receptor 5
Ligand Name
2-acetamido-2-deoxy-beta-D-glucopyranose
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
OVRNDRQMDRJTHS-FMDGEEDCSA-N
SMILES
CC(=O)NC1C(C(C(OC1O)CO)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4BSR
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4bsrA1e4bsrA2e4bsrB1e4bsrB2e4bsrC1e4bsrD1
ECOD domains from experimental PDB structures interacting with ligand DB00141
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| O75473 | DB00141 | NAG | 4bsr | e4bsrA1 | A:28-301 |
| O75473 | DB00141 | NAG | 4bsr | e4bsrB1 | B:31-301 |
| O75473 | DB00141 | NAG | 4bss | e4bssA5 | A:33-187,A:212-484,A:530-543 |
| O75473 | DB00141 | NAG | 4bss | e4bssB5 | B:28-256,B:281-485,B:533-543 |
| O75473 | DB00141 | NAG | 4bss | e4bssE4 | E:33-486,E:530-543 |
| O75473 | DB00141 | NAG | 4bss | e4bssF1 | F:33-485,F:533-543 |
| O75473 | DB00141 | NAG | 4bst | e4bstA5 | A:33-484,A:539-543 |
| O75473 | DB00141 | NAG | 4bst | e4bstB5 | B:33-485,B:539-543 |
| O75473 | DB00141 | NAG | 4bsu | e4bsuA5 | A:31-270,A:295-485,A:525-543 |
| O75473 | DB00141 | NAG | 4bsu | e4bsuB1 | B:33-270,B:295-485,B:526-543 |
| O75473 | DB00141 | NAG | 4bsu | e4bsuE5 | E:31-487,E:540-544 |
| O75473 | DB00141 | NAG | 4bsu | e4bsuF5 | F:30-186,F:211-485,F:537-543 |
| O75473 | DB00141 | NAG | 4kng | e4kngA5 | A:30-483,A:537-543 |
| O75473 | DB00141 | NAG | 4kng | e4kngB4 | B:30-482,B:537-546 |
| O75473 | DB00141 | NAG | 4ufr | e4ufrA1 | A:32-543 |
| O75473 | DB00141 | NAG | 4ufr | e4ufrC1 | C:33-543 |